![]() |
Name |
Diaporindene D
|
Molecular Formula | C25H30O6 | |
IUPAC Name* |
(2R,3S)-5-hydroxy-2-(2-hydroxypropan-2-yl)-3-[(3S)-3-(2-hydroxypropan-2-yl)-7-methyl-2,3-dihydro-1,4-benzodioxin-5-yl]-2,3-dihydro-1H-indene-4-carbaldehyde
|
|
SMILES |
CC1=CC(=C2C(=C1)OC[C@H](O2)C(C)(C)O)[C@H]3[C@@H](CC4=C3C(=C(C=C4)O)C=O)C(C)(C)O
|
|
InChI |
InChI=1S/C25H30O6/c1-13-8-15(23-19(9-13)30-12-20(31-23)25(4,5)29)22-17(24(2,3)28)10-14-6-7-18(27)16(11-26)21(14)22/h6-9,11,17,20,22,27-29H,10,12H2,1-5H3/t17-,20+,22+/m1/s1
|
|
InChIKey |
VKNKNPXXDILXOC-AGHHOFFYSA-N
|
|
Synonyms |
Diaporindene D
|
|
CAS | NA | |
PubChem CID | 139591470 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 426.5 | ALogp: | 3.6 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 96.2 | Aromatic Rings: | 4 |
Heavy Atoms: | 31 | QED Weighted: | 0.633 |
Caco-2 Permeability: | -4.655 | MDCK Permeability: | 0.00001300 |
Pgp-inhibitor: | 0.022 | Pgp-substrate: | 0.014 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.241 | Plasma Protein Binding (PPB): | 98.90% |
Volume Distribution (VD): | 0.592 | Fu: | 1.11% |
CYP1A2-inhibitor: | 0.06 | CYP1A2-substrate: | 0.227 |
CYP2C19-inhibitor: | 0.247 | CYP2C19-substrate: | 0.65 |
CYP2C9-inhibitor: | 0.47 | CYP2C9-substrate: | 0.911 |
CYP2D6-inhibitor: | 0.718 | CYP2D6-substrate: | 0.336 |
CYP3A4-inhibitor: | 0.44 | CYP3A4-substrate: | 0.689 |
Clearance (CL): | 5.424 | Half-life (T1/2): | 0.17 |
hERG Blockers: | 0.032 | Human Hepatotoxicity (H-HT): | 0.101 |
Drug-inuced Liver Injury (DILI): | 0.103 | AMES Toxicity: | 0.107 |
Rat Oral Acute Toxicity: | 0.21 | Maximum Recommended Daily Dose: | 0.929 |
Skin Sensitization: | 0.098 | Carcinogencity: | 0.556 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.052 |
Respiratory Toxicity: | 0.238 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003966 | ![]() |
1.000 | D0F7CS | ![]() |
0.277 | ||
ENC003965 | ![]() |
1.000 | D06AWE | ![]() |
0.254 | ||
ENC003964 | ![]() |
1.000 | D0H2JP | ![]() |
0.254 | ||
ENC003568 | ![]() |
0.523 | D07MGA | ![]() |
0.250 | ||
ENC003968 | ![]() |
0.523 | D00NJL | ![]() |
0.244 | ||
ENC003569 | ![]() |
0.523 | D04TDQ | ![]() |
0.243 | ||
ENC003942 | ![]() |
0.466 | D0W7WC | ![]() |
0.237 | ||
ENC004763 | ![]() |
0.442 | D0L1JW | ![]() |
0.233 | ||
ENC003963 | ![]() |
0.438 | D0WE3O | ![]() |
0.231 | ||
ENC003962 | ![]() |
0.438 | D0H6QU | ![]() |
0.226 |