![]() |
Name |
Rhizovarin C
|
Molecular Formula | C38H47NO7 | |
IUPAC Name* |
(1S,3S,7S,9R,10S,11R,16S,17S,26R,28S,29R)-3-methoxy-16,17,34,34-tetramethyl-25-methylidene-11-prop-1-en-2-yl-2,8,12,33-tetraoxa-19-azadecacyclo[26.4.2.03,17.06,16.07,9.07,13.018,32.020,31.023,30.026,29]tetratriaconta-18(32),20(31),21,23(30)-tetraene-10,29-diol
|
|
SMILES |
CC(=C)[C@@H]1[C@@H]([C@@H]2[C@]3(O2)C4CC[C@]5([C@@]([C@]4(CCC3O1)C)(C6=C7[C@H](O5)OC([C@H]8C[C@H]9[C@@]8(C1=C(CC9=C)C=CC(=C71)N6)O)(C)C)C)OC)O
|
|
InChI |
InChI=1S/C38H47NO7/c1-17(2)29-28(40)31-38(44-31)22-11-14-36(42-8)35(7,34(22,6)13-12-24(38)43-29)30-26-25-21(39-30)10-9-19-15-18(3)20-16-23(37(20,41)27(19)25)33(4,5)45-32(26)46-36/h9-10,20,22-24,28-29,31-32,39-41H,1,3,11-16H2,2,4-8H3/t20-,22?,23-,24?,28+,29-,31-,32+,34+,35-,36+,37-,38+/m1/s1
|
|
InChIKey |
SNWHIFFDXXXGBE-GKCNSDJDSA-N
|
|
Synonyms |
Rhizovarin C
|
|
CAS | NA | |
PubChem CID | 139589620 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 629.8 | ALogp: | 4.0 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 106.0 | Aromatic Rings: | 10 |
Heavy Atoms: | 46 | QED Weighted: | 0.286 |
Caco-2 Permeability: | -5.281 | MDCK Permeability: | 0.00000985 |
Pgp-inhibitor: | 0.996 | Pgp-substrate: | 0.991 |
Human Intestinal Absorption (HIA): | 0.017 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.208 |
Blood-Brain-Barrier Penetration (BBB): | 0.933 | Plasma Protein Binding (PPB): | 86.10% |
Volume Distribution (VD): | 2.191 | Fu: | 4.06% |
CYP1A2-inhibitor: | 0.013 | CYP1A2-substrate: | 0.994 |
CYP2C19-inhibitor: | 0.116 | CYP2C19-substrate: | 0.823 |
CYP2C9-inhibitor: | 0.246 | CYP2C9-substrate: | 0.037 |
CYP2D6-inhibitor: | 0.022 | CYP2D6-substrate: | 0.687 |
CYP3A4-inhibitor: | 0.88 | CYP3A4-substrate: | 0.914 |
Clearance (CL): | 7.897 | Half-life (T1/2): | 0.024 |
hERG Blockers: | 0.913 | Human Hepatotoxicity (H-HT): | 0.978 |
Drug-inuced Liver Injury (DILI): | 0.873 | AMES Toxicity: | 0.218 |
Rat Oral Acute Toxicity: | 0.976 | Maximum Recommended Daily Dose: | 0.991 |
Skin Sensitization: | 0.563 | Carcinogencity: | 0.881 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
Respiratory Toxicity: | 0.987 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003830 | ![]() |
0.843 | D03MTN | ![]() |
0.223 | ||
ENC001508 | ![]() |
0.656 | D0W2EK | ![]() |
0.220 | ||
ENC005404 | ![]() |
0.586 | D0KR9U | ![]() |
0.214 | ||
ENC001891 | ![]() |
0.546 | D0X7XG | ![]() |
0.214 | ||
ENC001499 | ![]() |
0.521 | D06AWE | ![]() |
0.213 | ||
ENC001507 | ![]() |
0.445 | D0H2JP | ![]() |
0.213 | ||
ENC001486 | ![]() |
0.441 | D06IIB | ![]() |
0.211 | ||
ENC003833 | ![]() |
0.408 | D0Y2YP | ![]() |
0.211 | ||
ENC003330 | ![]() |
0.386 | D02JNM | ![]() |
0.207 | ||
ENC003453 | ![]() |
0.380 | D0S0NK | ![]() |
0.207 |