![]() |
Name |
Stemphol D
|
Molecular Formula | C21H34O6 | |
IUPAC Name* |
(2S,3R,4R,5R,6S)-2-(3-butyl-2,4-dihydroxy-6-pentylphenyl)-6-methyloxane-3,4,5-triol
|
|
SMILES |
CCCCCC1=CC(=C(C(=C1[C@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)C)O)O)O)O)CCCC)O
|
|
InChI |
InChI=1S/C21H34O6/c1-4-6-8-9-13-11-15(22)14(10-7-5-2)18(24)16(13)21-20(26)19(25)17(23)12(3)27-21/h11-12,17,19-26H,4-10H2,1-3H3/t12-,17-,19+,20+,21-/m0/s1
|
|
InChIKey |
BXDSSSHSCHNSBQ-GCHCVLMDSA-N
|
|
Synonyms |
Stemphol D
|
|
CAS | NA | |
PubChem CID | 139589438 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 382.5 | ALogp: | 3.6 |
HBD: | 5 | HBA: | 6 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 110.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 27 | QED Weighted: | 0.44 |
Caco-2 Permeability: | -5.353 | MDCK Permeability: | 0.00001590 |
Pgp-inhibitor: | 0.123 | Pgp-substrate: | 0.986 |
Human Intestinal Absorption (HIA): | 0.652 | 20% Bioavailability (F20%): | 0.726 |
30% Bioavailability (F30%): | 0.875 |
Blood-Brain-Barrier Penetration (BBB): | 0.039 | Plasma Protein Binding (PPB): | 97.17% |
Volume Distribution (VD): | 1.38 | Fu: | 2.23% |
CYP1A2-inhibitor: | 0.249 | CYP1A2-substrate: | 0.731 |
CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.72 |
CYP2C9-inhibitor: | 0.215 | CYP2C9-substrate: | 0.969 |
CYP2D6-inhibitor: | 0.281 | CYP2D6-substrate: | 0.34 |
CYP3A4-inhibitor: | 0.03 | CYP3A4-substrate: | 0.025 |
Clearance (CL): | 4.846 | Half-life (T1/2): | 0.626 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.132 |
Drug-inuced Liver Injury (DILI): | 0.038 | AMES Toxicity: | 0.662 |
Rat Oral Acute Toxicity: | 0.231 | Maximum Recommended Daily Dose: | 0.133 |
Skin Sensitization: | 0.947 | Carcinogencity: | 0.027 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.276 |
Respiratory Toxicity: | 0.825 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D00HCQ | ![]() |
0.294 | ||||
![]() |
D0O1UZ | ![]() |
0.283 | ||||
![]() |
D01TNW | ![]() |
0.280 | ||||
![]() |
D0P1FO | ![]() |
0.269 | ||||
![]() |
D0L7AS | ![]() |
0.246 | ||||
![]() |
D06BQU | ![]() |
0.243 | ||||
![]() |
D0HR8Z | ![]() |
0.242 | ||||
![]() |
D08DFX | ![]() |
0.240 | ||||
![]() |
D0H3KI | ![]() |
0.238 | ||||
![]() |
D0I9HF | ![]() |
0.232 |