![]() |
Name |
Lecanorin F
|
Molecular Formula | C16H16O5 | |
IUPAC Name* |
(3-hydroxy-2,5-dimethylphenyl) 2,4-dihydroxy-6-methylbenzoate
|
|
SMILES |
CC1=CC(=C(C(=C1)OC(=O)C2=C(C=C(C=C2C)O)O)C)O
|
|
InChI |
InChI=1S/C16H16O5/c1-8-4-12(18)10(3)14(5-8)21-16(20)15-9(2)6-11(17)7-13(15)19/h4-7,17-19H,1-3H3
|
|
InChIKey |
CCEOVCDVGADDPO-UHFFFAOYSA-N
|
|
Synonyms |
Lecanorin F
|
|
CAS | NA | |
PubChem CID | 139587577 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 288.29 | ALogp: | 3.9 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.579 |
Caco-2 Permeability: | -5.023 | MDCK Permeability: | 0.00001510 |
Pgp-inhibitor: | 0.015 | Pgp-substrate: | 0.067 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.976 |
30% Bioavailability (F30%): | 0.478 |
Blood-Brain-Barrier Penetration (BBB): | 0.078 | Plasma Protein Binding (PPB): | 98.94% |
Volume Distribution (VD): | 0.423 | Fu: | 1.21% |
CYP1A2-inhibitor: | 0.959 | CYP1A2-substrate: | 0.885 |
CYP2C19-inhibitor: | 0.654 | CYP2C19-substrate: | 0.063 |
CYP2C9-inhibitor: | 0.673 | CYP2C9-substrate: | 0.827 |
CYP2D6-inhibitor: | 0.775 | CYP2D6-substrate: | 0.697 |
CYP3A4-inhibitor: | 0.483 | CYP3A4-substrate: | 0.168 |
Clearance (CL): | 14.212 | Half-life (T1/2): | 0.894 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.017 |
Drug-inuced Liver Injury (DILI): | 0.358 | AMES Toxicity: | 0.146 |
Rat Oral Acute Toxicity: | 0.345 | Maximum Recommended Daily Dose: | 0.936 |
Skin Sensitization: | 0.935 | Carcinogencity: | 0.041 |
Eye Corrosion: | 0.375 | Eye Irritation: | 0.972 |
Respiratory Toxicity: | 0.55 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003732 | ![]() |
0.701 | D07MGA | ![]() |
0.345 | ||
ENC003724 | ![]() |
0.672 | D04AIT | ![]() |
0.326 | ||
ENC004713 | ![]() |
0.667 | D0K8KX | ![]() |
0.303 | ||
ENC003758 | ![]() |
0.636 | D0FA2O | ![]() |
0.288 | ||
ENC003695 | ![]() |
0.622 | D07EXH | ![]() |
0.270 | ||
ENC002591 | ![]() |
0.534 | D0Y7PG | ![]() |
0.264 | ||
ENC002461 | ![]() |
0.533 | D06GCK | ![]() |
0.263 | ||
ENC005123 | ![]() |
0.528 | D0H2ZW | ![]() |
0.258 | ||
ENC002944 | ![]() |
0.527 | D0JO3U | ![]() |
0.255 | ||
ENC000936 | ![]() |
0.519 | D05VIX | ![]() |
0.253 |