![]() |
Name |
Phomo-2,3-dihydrochromone
|
Molecular Formula | C15H12O6 | |
IUPAC Name* |
5-hydroxy-7-methoxy-3-(4-methyl-5-oxofuran-2-ylidene)chromen-4-one
|
|
SMILES |
CC1=CC(=C2COC3=CC(=CC(=C3C2=O)O)OC)OC1=O
|
|
InChI |
InChI=1S/C15H12O6/c1-7-3-11(21-15(7)18)9-6-20-12-5-8(19-2)4-10(16)13(12)14(9)17/h3-5,16H,6H2,1-2H3
|
|
InChIKey |
AVUKMQFSADCLAL-UHFFFAOYSA-N
|
|
Synonyms |
Phomo-2,3-dihydrochromone
|
|
CAS | NA | |
PubChem CID | 139585573 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 288.25 | ALogp: | 2.0 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 82.1 | Aromatic Rings: | 3 |
Heavy Atoms: | 21 | QED Weighted: | 0.631 |
Caco-2 Permeability: | -4.744 | MDCK Permeability: | 0.00001310 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.097 |
Human Intestinal Absorption (HIA): | 0.022 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.796 |
Blood-Brain-Barrier Penetration (BBB): | 0.009 | Plasma Protein Binding (PPB): | 91.07% |
Volume Distribution (VD): | 0.525 | Fu: | 9.61% |
CYP1A2-inhibitor: | 0.955 | CYP1A2-substrate: | 0.864 |
CYP2C19-inhibitor: | 0.122 | CYP2C19-substrate: | 0.06 |
CYP2C9-inhibitor: | 0.618 | CYP2C9-substrate: | 0.821 |
CYP2D6-inhibitor: | 0.656 | CYP2D6-substrate: | 0.708 |
CYP3A4-inhibitor: | 0.4 | CYP3A4-substrate: | 0.111 |
Clearance (CL): | 4.497 | Half-life (T1/2): | 0.629 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.236 |
Drug-inuced Liver Injury (DILI): | 0.681 | AMES Toxicity: | 0.026 |
Rat Oral Acute Toxicity: | 0.59 | Maximum Recommended Daily Dose: | 0.361 |
Skin Sensitization: | 0.315 | Carcinogencity: | 0.427 |
Eye Corrosion: | 0.023 | Eye Irritation: | 0.663 |
Respiratory Toxicity: | 0.252 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000880 | ![]() |
0.456 | D07MGA | ![]() |
0.293 | ||
ENC005111 | ![]() |
0.436 | D0L1JW | ![]() |
0.255 | ||
ENC002089 | ![]() |
0.430 | D04UTT | ![]() |
0.248 | ||
ENC000930 | ![]() |
0.420 | D0G4KG | ![]() |
0.247 | ||
ENC002311 | ![]() |
0.420 | D06GCK | ![]() |
0.245 | ||
ENC002171 | ![]() |
0.420 | D0C1SF | ![]() |
0.242 | ||
ENC005227 | ![]() |
0.420 | D0FA2O | ![]() |
0.235 | ||
ENC000362 | ![]() |
0.420 | D0D4HN | ![]() |
0.233 | ||
ENC005309 | ![]() |
0.418 | D04TDQ | ![]() |
0.233 | ||
ENC002517 | ![]() |
0.415 | D02PMO | ![]() |
0.231 |