![]() |
Name |
(+)-neopestalotin E
|
Molecular Formula | C15H21NO5 | |
IUPAC Name* |
[(E)-3-methyl-5-oxo-5-[[(2S)-2,4,5-trimethyl-3-oxofuran-2-yl]amino]pent-3-enyl] acetate
|
|
SMILES |
CC1=C(O[C@](C1=O)(C)NC(=O)/C=C(\C)/CCOC(=O)C)C
|
|
InChI |
InChI=1S/C15H21NO5/c1-9(6-7-20-12(4)17)8-13(18)16-15(5)14(19)10(2)11(3)21-15/h8H,6-7H2,1-5H3,(H,16,18)/b9-8+/t15-/m0/s1
|
|
InChIKey |
LNXFKXGYRFJRIN-HVHJFMEUSA-N
|
|
Synonyms |
(+)-neopestalotin E
|
|
CAS | NA | |
PubChem CID | 139584770 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 295.33 | ALogp: | 1.7 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 81.7 | Aromatic Rings: | 1 |
Heavy Atoms: | 21 | QED Weighted: | 0.621 |
Caco-2 Permeability: | -4.714 | MDCK Permeability: | 0.00011412 |
Pgp-inhibitor: | 0.04 | Pgp-substrate: | 0.015 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.044 |
30% Bioavailability (F30%): | 0.717 |
Blood-Brain-Barrier Penetration (BBB): | 0.966 | Plasma Protein Binding (PPB): | 36.60% |
Volume Distribution (VD): | 0.786 | Fu: | 52.26% |
CYP1A2-inhibitor: | 0.036 | CYP1A2-substrate: | 0.117 |
CYP2C19-inhibitor: | 0.159 | CYP2C19-substrate: | 0.59 |
CYP2C9-inhibitor: | 0.041 | CYP2C9-substrate: | 0.063 |
CYP2D6-inhibitor: | 0.021 | CYP2D6-substrate: | 0.087 |
CYP3A4-inhibitor: | 0.128 | CYP3A4-substrate: | 0.384 |
Clearance (CL): | 6.711 | Half-life (T1/2): | 0.816 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.536 |
Drug-inuced Liver Injury (DILI): | 0.882 | AMES Toxicity: | 0.017 |
Rat Oral Acute Toxicity: | 0.02 | Maximum Recommended Daily Dose: | 0.018 |
Skin Sensitization: | 0.899 | Carcinogencity: | 0.049 |
Eye Corrosion: | 0.371 | Eye Irritation: | 0.321 |
Respiratory Toxicity: | 0.767 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005356 | ![]() |
0.433 | D0Q6DX | ![]() |
0.253 | ||
ENC005948 | ![]() |
0.288 | D0Q9HF | ![]() |
0.250 | ||
ENC005947 | ![]() |
0.288 | D0WY9N | ![]() |
0.222 | ||
ENC004635 | ![]() |
0.278 | D01ZEC | ![]() |
0.219 | ||
ENC005596 | ![]() |
0.278 | D0OL7F | ![]() |
0.214 | ||
ENC003133 | ![]() |
0.276 | D09SIK | ![]() |
0.214 | ||
ENC006075 | ![]() |
0.273 | D0B1IP | ![]() |
0.214 | ||
ENC004528 | ![]() |
0.273 | D09WYX | ![]() |
0.212 | ||
ENC002761 | ![]() |
0.272 | D0V2JK | ![]() |
0.206 | ||
ENC005386 | ![]() |
0.272 | D0I5HV | ![]() |
0.205 |