|
Name |
(5S)-3-[[(1S,2R,4aS,6R,8aR)-1,6-dimethyl-2-[(1E,3E)-penta-1,3-dienyl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-hydroxymethylidene]-5-(1-hydroxyethyl)pyrrolidine-2,4-dione
|
Molecular Formula | C24H33NO4 | |
IUPAC Name* |
(5S)-3-[[(1S,2R,4aS,6R,8aR)-1,6-dimethyl-2-[(1E,3E)-penta-1,3-dienyl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-hydroxymethylidene]-5-(1-hydroxyethyl)pyrrolidine-2,4-dione
|
|
SMILES |
C/C=C/C=C/[C@@H]1C=C[C@@H]2C[C@@H](CC[C@H]2[C@]1(C)C(=C3C(=O)[C@@H](NC3=O)C(C)O)O)C
|
|
InChI |
InChI=1S/C24H33NO4/c1-5-6-7-8-17-11-10-16-13-14(2)9-12-18(16)24(17,4)22(28)19-21(27)20(15(3)26)25-23(19)29/h5-8,10-11,14-18,20,26,28H,9,12-13H2,1-4H3,(H,25,29)/b6-5+,8-7+,22-19?/t14-,15?,16-,17-,18-,20+,24-/m1/s1
|
|
InChIKey |
AIFXMSDWXBFQTF-LJTITLJISA-N
|
|
Synonyms |
Altersetin
|
|
CAS | NA | |
PubChem CID | 139584731 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 399.5 | ALogp: | 5.0 |
HBD: | 3 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 86.6 | Aromatic Rings: | 3 |
Heavy Atoms: | 29 | QED Weighted: | 0.216 |
Caco-2 Permeability: | -4.831 | MDCK Permeability: | 0.00000871 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.217 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.243 | Plasma Protein Binding (PPB): | 96.03% |
Volume Distribution (VD): | 0.982 | Fu: | 5.44% |
CYP1A2-inhibitor: | 0.749 | CYP1A2-substrate: | 0.845 |
CYP2C19-inhibitor: | 0.55 | CYP2C19-substrate: | 0.278 |
CYP2C9-inhibitor: | 0.901 | CYP2C9-substrate: | 0.976 |
CYP2D6-inhibitor: | 0.924 | CYP2D6-substrate: | 0.881 |
CYP3A4-inhibitor: | 0.851 | CYP3A4-substrate: | 0.301 |
Clearance (CL): | 1.308 | Half-life (T1/2): | 0.484 |
hERG Blockers: | 0.05 | Human Hepatotoxicity (H-HT): | 0.265 |
Drug-inuced Liver Injury (DILI): | 0.774 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.724 | Maximum Recommended Daily Dose: | 0.571 |
Skin Sensitization: | 0.313 | Carcinogencity: | 0.375 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.02 |
Respiratory Toxicity: | 0.941 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003021 | 0.674 | D04SFH | 0.235 | ||||
ENC004028 | 0.600 | D0O5FY | 0.233 | ||||
ENC003491 | 0.579 | D0I5DS | 0.226 | ||||
ENC003745 | 0.528 | D06AEO | 0.220 | ||||
ENC002818 | 0.524 | D0W2EK | 0.218 | ||||
ENC003689 | 0.515 | D0P0HT | 0.218 | ||||
ENC003132 | 0.437 | D0D2TN | 0.216 | ||||
ENC005182 | 0.389 | D0CZ1Q | 0.216 | ||||
ENC005181 | 0.389 | D08PIQ | 0.216 | ||||
ENC004320 | 0.339 | D0I2SD | 0.215 |