![]() |
Name |
Pullularin F
|
Molecular Formula | C38H52N4O9 | |
IUPAC Name* |
(2S)-2-[[(2S,3S)-2-[[(2S)-3-hydroxy-2-[[(2S)-1-(2-hydroxy-3-phenylpropanoyl)pyrrolidine-2-carbonyl]amino]propanoyl]-methylamino]-3-methylpentanoyl]amino]-3-[4-(3-methylbut-2-enoxy)phenyl]propanoic acid
|
|
SMILES |
CC[C@H](C)[C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)OCC=C(C)C)C(=O)O)N(C)C(=O)[C@H](CO)NC(=O)[C@@H]2CCCN2C(=O)C(CC3=CC=CC=C3)O
|
|
InChI |
InChI=1S/C38H52N4O9/c1-6-25(4)33(35(46)39-29(38(49)50)21-27-14-16-28(17-15-27)51-20-18-24(2)3)41(5)36(47)30(23-43)40-34(45)31-13-10-19-42(31)37(48)32(44)22-26-11-8-7-9-12-26/h7-9,11-12,14-18,25,29-33,43-44H,6,10,13,19-23H2,1-5H3,(H,39,46)(H,40,45)(H,49,50)/t25-,29-,30-,31-,32?,33-/m0/s1
|
|
InChIKey |
HGRKCBGERCWAPT-AJLYFVEGSA-N
|
|
Synonyms |
Pullularin F
|
|
CAS | NA | |
PubChem CID | 139583147 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 708.8 | ALogp: | 3.9 |
HBD: | 5 | HBA: | 9 |
Rotatable Bonds: | 18 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 186.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 51 | QED Weighted: | 0.145 |
Caco-2 Permeability: | -6.135 | MDCK Permeability: | 0.00006770 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.935 |
Human Intestinal Absorption (HIA): | 0.953 | 20% Bioavailability (F20%): | 0.464 |
30% Bioavailability (F30%): | 0.974 |
Blood-Brain-Barrier Penetration (BBB): | 0.031 | Plasma Protein Binding (PPB): | 89.46% |
Volume Distribution (VD): | 0.232 | Fu: | 6.93% |
CYP1A2-inhibitor: | 0.005 | CYP1A2-substrate: | 0.035 |
CYP2C19-inhibitor: | 0.074 | CYP2C19-substrate: | 0.081 |
CYP2C9-inhibitor: | 0.135 | CYP2C9-substrate: | 0.874 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.171 |
CYP3A4-inhibitor: | 0.211 | CYP3A4-substrate: | 0.119 |
Clearance (CL): | 3.345 | Half-life (T1/2): | 0.816 |
hERG Blockers: | 0.038 | Human Hepatotoxicity (H-HT): | 0.972 |
Drug-inuced Liver Injury (DILI): | 0.917 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.798 | Maximum Recommended Daily Dose: | 0.178 |
Skin Sensitization: | 0.037 | Carcinogencity: | 0.031 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
Respiratory Toxicity: | 0.015 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002115 | ![]() |
0.389 | D0X5SJ | ![]() |
0.447 | ||
ENC005220 | ![]() |
0.368 | D0G6SE | ![]() |
0.430 | ||
ENC005267 | ![]() |
0.362 | D00VFE | ![]() |
0.349 | ||
ENC002484 | ![]() |
0.355 | D0N5HJ | ![]() |
0.348 | ||
ENC002483 | ![]() |
0.341 | D00SEB | ![]() |
0.344 | ||
ENC001266 | ![]() |
0.328 | D07HGR | ![]() |
0.339 | ||
ENC004263 | ![]() |
0.307 | D00UVA | ![]() |
0.338 | ||
ENC000810 | ![]() |
0.301 | D0U5GB | ![]() |
0.337 | ||
ENC001906 | ![]() |
0.295 | D04ASH | ![]() |
0.327 | ||
ENC003692 | ![]() |
0.293 | D01AHO | ![]() |
0.326 |