![]() |
Name |
Diaporphasine B
|
Molecular Formula | C17H15NO6 | |
IUPAC Name* |
methyl 6,7-dimethoxy-3-methyl-10-oxochromeno[3,2-c]pyridine-9-carboxylate
|
|
SMILES |
CC1=CC2=C(C=N1)C(=O)C3=C(O2)C(=C(C=C3C(=O)OC)OC)OC
|
|
InChI |
InChI=1S/C17H15NO6/c1-8-5-11-10(7-18-8)14(19)13-9(17(20)23-4)6-12(21-2)15(22-3)16(13)24-11/h5-7H,1-4H3
|
|
InChIKey |
DSIZIDLZALKUMH-UHFFFAOYSA-N
|
|
Synonyms |
Diaporphasine B; CHEMBL4104397
|
|
CAS | NA | |
PubChem CID | 137658545 | |
ChEMBL ID | CHEMBL4104397 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 329.3 | ALogp: | 2.1 |
HBD: | 0 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 84.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 24 | QED Weighted: | 0.538 |
Caco-2 Permeability: | -4.611 | MDCK Permeability: | 0.00003550 |
Pgp-inhibitor: | 0.091 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.009 |
Blood-Brain-Barrier Penetration (BBB): | 0.505 | Plasma Protein Binding (PPB): | 72.96% |
Volume Distribution (VD): | 1.104 | Fu: | 26.45% |
CYP1A2-inhibitor: | 0.677 | CYP1A2-substrate: | 0.981 |
CYP2C19-inhibitor: | 0.335 | CYP2C19-substrate: | 0.817 |
CYP2C9-inhibitor: | 0.343 | CYP2C9-substrate: | 0.861 |
CYP2D6-inhibitor: | 0.085 | CYP2D6-substrate: | 0.674 |
CYP3A4-inhibitor: | 0.38 | CYP3A4-substrate: | 0.331 |
Clearance (CL): | 3.299 | Half-life (T1/2): | 0.662 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.498 |
Drug-inuced Liver Injury (DILI): | 0.97 | AMES Toxicity: | 0.483 |
Rat Oral Acute Toxicity: | 0.426 | Maximum Recommended Daily Dose: | 0.049 |
Skin Sensitization: | 0.123 | Carcinogencity: | 0.033 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.046 |
Respiratory Toxicity: | 0.411 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003537 | ![]() |
0.827 | D0G4KG | ![]() |
0.368 | ||
ENC004956 | ![]() |
0.792 | D06GCK | ![]() |
0.350 | ||
ENC003543 | ![]() |
0.649 | D0AO5H | ![]() |
0.333 | ||
ENC002197 | ![]() |
0.523 | D09DHY | ![]() |
0.327 | ||
ENC003814 | ![]() |
0.489 | D0Y7TS | ![]() |
0.318 | ||
ENC002404 | ![]() |
0.467 | D02LZB | ![]() |
0.306 | ||
ENC004951 | ![]() |
0.460 | D0C1SF | ![]() |
0.284 | ||
ENC004950 | ![]() |
0.460 | D0O6KE | ![]() |
0.280 | ||
ENC003547 | ![]() |
0.460 | D0NJ3V | ![]() |
0.280 | ||
ENC003858 | ![]() |
0.441 | D0D4HN | ![]() |
0.280 |