![]() |
Name |
Izumiphenazine C
|
Molecular Formula | C20H15N3O3 | |
IUPAC Name* |
4-[(6-hydroxyphenazin-1-yl)-methylamino]benzoic acid
|
|
SMILES |
CN(C1=CC=C(C=C1)C(=O)O)C2=CC=CC3=C2N=C4C=CC=C(C4=N3)O
|
|
InChI |
InChI=1S/C20H15N3O3/c1-23(13-10-8-12(9-11-13)20(25)26)16-6-2-4-14-18(16)21-15-5-3-7-17(24)19(15)22-14/h2-11,24H,1H3,(H,25,26)
|
|
InChIKey |
REOKRAKOSOITAV-UHFFFAOYSA-N
|
|
Synonyms |
Izumiphenazine C; CHEBI:70230; CHEMBL1651327; Q27138570
|
|
CAS | NA | |
PubChem CID | 136054934 | |
ChEMBL ID | CHEMBL1651327 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 345.4 | ALogp: | 3.5 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 86.6 | Aromatic Rings: | 4 |
Heavy Atoms: | 26 | QED Weighted: | 0.528 |
Caco-2 Permeability: | -5.05 | MDCK Permeability: | 0.00001590 |
Pgp-inhibitor: | 0.012 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.022 | Plasma Protein Binding (PPB): | 96.82% |
Volume Distribution (VD): | 0.334 | Fu: | 1.74% |
CYP1A2-inhibitor: | 0.255 | CYP1A2-substrate: | 0.214 |
CYP2C19-inhibitor: | 0.043 | CYP2C19-substrate: | 0.057 |
CYP2C9-inhibitor: | 0.349 | CYP2C9-substrate: | 0.092 |
CYP2D6-inhibitor: | 0.682 | CYP2D6-substrate: | 0.089 |
CYP3A4-inhibitor: | 0.08 | CYP3A4-substrate: | 0.171 |
Clearance (CL): | 1.311 | Half-life (T1/2): | 0.799 |
hERG Blockers: | 0.137 | Human Hepatotoxicity (H-HT): | 0.828 |
Drug-inuced Liver Injury (DILI): | 0.989 | AMES Toxicity: | 0.356 |
Rat Oral Acute Toxicity: | 0.318 | Maximum Recommended Daily Dose: | 0.023 |
Skin Sensitization: | 0.072 | Carcinogencity: | 0.188 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.063 |
Respiratory Toxicity: | 0.848 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002351 | ![]() |
0.310 | D0Q5UQ | ![]() |
0.426 | ||
ENC001962 | ![]() |
0.310 | D0D5SQ | ![]() |
0.318 | ||
ENC003201 | ![]() |
0.308 | D0L0SW | ![]() |
0.314 | ||
ENC003644 | ![]() |
0.306 | D05FGG | ![]() |
0.313 | ||
ENC002352 | ![]() |
0.298 | D04VKS | ![]() |
0.308 | ||
ENC000996 | ![]() |
0.297 | D00PEH | ![]() |
0.307 | ||
ENC000007 | ![]() |
0.295 | D0M7JT | ![]() |
0.301 | ||
ENC004888 | ![]() |
0.292 | D06FOU | ![]() |
0.298 | ||
ENC000087 | ![]() |
0.292 | D02ZTJ | ![]() |
0.297 | ||
ENC003516 | ![]() |
0.290 | D0N6RF | ![]() |
0.292 |