![]() |
Name |
Aspernolide I
|
Molecular Formula | C25H28O9 | |
IUPAC Name* |
methyl (2R)-2-[[3-[(2S)-2,3-dihydroxy-3-methylbutyl]-4-hydroxyphenyl]methyl]-3-(4-hydroxyphenyl)-4-methoxy-5-oxofuran-2-carboxylate
|
|
SMILES |
CC(C)([C@H](CC1=C(C=CC(=C1)C[C@@]2(C(=C(C(=O)O2)OC)C3=CC=C(C=C3)O)C(=O)OC)O)O)O
|
|
InChI |
InChI=1S/C25H28O9/c1-24(2,31)19(28)12-16-11-14(5-10-18(16)27)13-25(23(30)33-4)20(21(32-3)22(29)34-25)15-6-8-17(26)9-7-15/h5-11,19,26-28,31H,12-13H2,1-4H3/t19-,25+/m0/s1
|
|
InChIKey |
DOBNLAOKYKLRPS-UQBPGWFLSA-N
|
|
Synonyms |
Aspernolide I; methyl (2R)-2-[[3-[(2S)-2,3-dihydroxy-3-methyl-butyl]-4-hydroxy-phenyl]methyl]-3-(4-hydroxyphenyl)-4-methoxy-5-oxo-furan-2-carboxylate
|
|
CAS | NA | |
PubChem CID | 134816408 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 472.5 | ALogp: | 2.3 |
HBD: | 4 | HBA: | 9 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 143.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 34 | QED Weighted: | 0.426 |
Caco-2 Permeability: | -5.112 | MDCK Permeability: | 0.00001620 |
Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.02 |
Human Intestinal Absorption (HIA): | 0.102 | 20% Bioavailability (F20%): | 0.909 |
30% Bioavailability (F30%): | 0.986 |
Blood-Brain-Barrier Penetration (BBB): | 0.286 | Plasma Protein Binding (PPB): | 96.81% |
Volume Distribution (VD): | 0.41 | Fu: | 3.53% |
CYP1A2-inhibitor: | 0.379 | CYP1A2-substrate: | 0.534 |
CYP2C19-inhibitor: | 0.793 | CYP2C19-substrate: | 0.306 |
CYP2C9-inhibitor: | 0.875 | CYP2C9-substrate: | 0.741 |
CYP2D6-inhibitor: | 0.811 | CYP2D6-substrate: | 0.246 |
CYP3A4-inhibitor: | 0.906 | CYP3A4-substrate: | 0.598 |
Clearance (CL): | 9.841 | Half-life (T1/2): | 0.911 |
hERG Blockers: | 0.044 | Human Hepatotoxicity (H-HT): | 0.318 |
Drug-inuced Liver Injury (DILI): | 0.898 | AMES Toxicity: | 0.056 |
Rat Oral Acute Toxicity: | 0.184 | Maximum Recommended Daily Dose: | 0.776 |
Skin Sensitization: | 0.072 | Carcinogencity: | 0.05 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.029 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003493 | ![]() |
1.000 | D0Q9ON | ![]() |
0.331 | ||
ENC002705 | ![]() |
0.847 | D06KYN | ![]() |
0.308 | ||
ENC002711 | ![]() |
0.847 | D04UTT | ![]() |
0.308 | ||
ENC003113 | ![]() |
0.748 | D0J7RK | ![]() |
0.305 | ||
ENC002552 | ![]() |
0.705 | D04XEG | ![]() |
0.297 | ||
ENC003410 | ![]() |
0.664 | D04KJO | ![]() |
0.296 | ||
ENC002729 | ![]() |
0.639 | D0Q1IT | ![]() |
0.296 | ||
ENC000875 | ![]() |
0.639 | D0D1DI | ![]() |
0.296 | ||
ENC002376 | ![]() |
0.627 | D00LFB | ![]() |
0.280 | ||
ENC003498 | ![]() |
0.619 | D0U3YB | ![]() |
0.277 |