|
Name |
Preussilide D
|
Molecular Formula | C25H32O4 | |
IUPAC Name* |
(2E,4Z,6E)-7-[(1R,6R,8S,8aS)-3,6,8-trimethyl-7-oxo-2-(2-oxopropyl)-5,6,8,8a-tetrahydro-1H-naphthalen-1-yl]-4,6-dimethylhepta-2,4,6-trienoic acid
|
|
SMILES |
C[C@@H]1CC2=CC(=C([C@@H]([C@H]2[C@@H](C1=O)C)/C=C(\C)/C=C(/C)\C=C\C(=O)O)CC(=O)C)C
|
|
InChI |
InChI=1S/C25H32O4/c1-14(7-8-23(27)28)9-15(2)10-22-21(13-18(5)26)16(3)11-20-12-17(4)25(29)19(6)24(20)22/h7-11,17,19,22,24H,12-13H2,1-6H3,(H,27,28)/b8-7+,14-9-,15-10+/t17-,19+,22+,24+/m1/s1
|
|
InChIKey |
MSPOBTULOAJOIR-FFGGKKJLSA-N
|
|
Synonyms |
Preussilide D; CHEMBL4127726; J3.662.983E
|
|
CAS | NA | |
PubChem CID | 132489955 | |
ChEMBL ID | CHEMBL4127726 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 396.5 | ALogp: | 3.8 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 71.4 | Aromatic Rings: | 2 |
Heavy Atoms: | 29 | QED Weighted: | 0.475 |
Caco-2 Permeability: | -4.855 | MDCK Permeability: | 0.00002620 |
Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.009 |
Human Intestinal Absorption (HIA): | 0.177 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.017 | Plasma Protein Binding (PPB): | 97.28% |
Volume Distribution (VD): | 1.61 | Fu: | 1.71% |
CYP1A2-inhibitor: | 0.041 | CYP1A2-substrate: | 0.125 |
CYP2C19-inhibitor: | 0.09 | CYP2C19-substrate: | 0.694 |
CYP2C9-inhibitor: | 0.466 | CYP2C9-substrate: | 0.58 |
CYP2D6-inhibitor: | 0.033 | CYP2D6-substrate: | 0.118 |
CYP3A4-inhibitor: | 0.132 | CYP3A4-substrate: | 0.464 |
Clearance (CL): | 2.302 | Half-life (T1/2): | 0.81 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.207 |
Drug-inuced Liver Injury (DILI): | 0.86 | AMES Toxicity: | 0.082 |
Rat Oral Acute Toxicity: | 0.638 | Maximum Recommended Daily Dose: | 0.899 |
Skin Sensitization: | 0.775 | Carcinogencity: | 0.514 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.983 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003386 | 1.000 | D05QDC | 0.294 | ||||
ENC003389 | 0.847 | D02DGU | 0.271 | ||||
ENC003384 | 0.791 | D0G3PI | 0.271 | ||||
ENC003385 | 0.750 | D00DKK | 0.271 | ||||
ENC003388 | 0.688 | D0B1IP | 0.256 | ||||
ENC003852 | 0.323 | D0FG6M | 0.209 | ||||
ENC003854 | 0.300 | D0S7WX | 0.207 | ||||
ENC003853 | 0.300 | D0E9KA | 0.205 | ||||
ENC003429 | 0.256 | D06BLQ | 0.199 | ||||
ENC005575 | 0.250 | D0V2JK | 0.198 |