![]() |
Name |
3-Hydroxy-5-[[4-hydroxy-3-(3-methyl-2-buten-1-yl) phenyl]methyl]-4-(4-hydroxyphenyl)-2(5h)-furanone
|
Molecular Formula | C22H22O5 | |
IUPAC Name* |
4-hydroxy-2-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-3-(4-hydroxyphenyl)-2H-furan-5-one
|
|
SMILES |
CC(=CCC1=C(C=CC(=C1)CC2C(=C(C(=O)O2)O)C3=CC=C(C=C3)O)O)C
|
|
InChI |
InChI=1S/C22H22O5/c1-13(2)3-5-16-11-14(4-10-18(16)24)12-19-20(21(25)22(26)27-19)15-6-8-17(23)9-7-15/h3-4,6-11,19,23-25H,5,12H2,1-2H3
|
|
InChIKey |
SDUGYQDMSWYSGN-UHFFFAOYSA-N
|
|
Synonyms |
J3.646.197G; 3-hydroxy-5-[[4-hydroxy-3-(3-methyl-2-buten-1-yl) phenyl]methyl]-4-(4-hydroxyphenyl)-2(5h)-furanone; 3-Hydroxy-5-[[4-hydroxy-3-(3-methyl-2-butenyl)phenyl]methyl]-4-(4-hydroxyphenyl)-2,5-dihydrofuran-2-one
|
|
CAS | NA | |
PubChem CID | 129774388 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 366.4 | ALogp: | 4.5 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 27 | QED Weighted: | 0.529 |
Caco-2 Permeability: | -4.863 | MDCK Permeability: | 0.00001420 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.018 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.779 |
30% Bioavailability (F30%): | 0.029 |
Blood-Brain-Barrier Penetration (BBB): | 0.021 | Plasma Protein Binding (PPB): | 100.89% |
Volume Distribution (VD): | 0.668 | Fu: | 0.83% |
CYP1A2-inhibitor: | 0.765 | CYP1A2-substrate: | 0.122 |
CYP2C19-inhibitor: | 0.694 | CYP2C19-substrate: | 0.056 |
CYP2C9-inhibitor: | 0.686 | CYP2C9-substrate: | 0.902 |
CYP2D6-inhibitor: | 0.701 | CYP2D6-substrate: | 0.68 |
CYP3A4-inhibitor: | 0.172 | CYP3A4-substrate: | 0.213 |
Clearance (CL): | 14.276 | Half-life (T1/2): | 0.794 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.741 |
Drug-inuced Liver Injury (DILI): | 0.979 | AMES Toxicity: | 0.109 |
Rat Oral Acute Toxicity: | 0.463 | Maximum Recommended Daily Dose: | 0.028 |
Skin Sensitization: | 0.675 | Carcinogencity: | 0.242 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.38 |
Respiratory Toxicity: | 0.11 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004319 | ![]() |
0.663 | D0J7RK | ![]() |
0.356 | ||
ENC002729 | ![]() |
0.633 | D06KYN | ![]() |
0.333 | ||
ENC000875 | ![]() |
0.633 | D04XEG | ![]() |
0.308 | ||
ENC005357 | ![]() |
0.630 | D04AIT | ![]() |
0.304 | ||
ENC005358 | ![]() |
0.619 | D0Q0PR | ![]() |
0.302 | ||
ENC005298 | ![]() |
0.582 | D00LFB | ![]() |
0.301 | ||
ENC005297 | ![]() |
0.582 | D0U3YB | ![]() |
0.298 | ||
ENC003113 | ![]() |
0.567 | D0Y2NE | ![]() |
0.297 | ||
ENC003410 | ![]() |
0.551 | D0Q9ON | ![]() |
0.296 | ||
ENC005359 | ![]() |
0.535 | D06TJJ | ![]() |
0.289 |