![]() |
Name |
(8S,9R,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione
|
Molecular Formula | C29H48O2 | |
IUPAC Name* |
(8S,9R,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione
|
|
SMILES |
CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@@H]3[C@H]2CC(=O)C4[C@@]3(CCC(=O)C4)C)C)C(C)C
|
|
InChI |
InChI=1S/C29H48O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-22-17-27(31)26-16-21(30)12-14-29(26,6)25(22)13-15-28(23,24)5/h18-20,22-26H,7-17H2,1-6H3/t19-,20-,22+,23-,24+,25-,26?,28-,29-/m1/s1
|
|
InChIKey |
HMMVBUVVQLUGQA-NJCITMMCSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | 126969890 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 428.7 | ALogp: | 8.1 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 34.1 | Aromatic Rings: | 4 |
Heavy Atoms: | 31 | QED Weighted: | 0.434 |
Caco-2 Permeability: | -4.95 | MDCK Permeability: | 0.00002370 |
Pgp-inhibitor: | 0.968 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.986 |
30% Bioavailability (F30%): | 0.991 |
Blood-Brain-Barrier Penetration (BBB): | 0.237 | Plasma Protein Binding (PPB): | 93.35% |
Volume Distribution (VD): | 1.368 | Fu: | 1.40% |
CYP1A2-inhibitor: | 0.081 | CYP1A2-substrate: | 0.639 |
CYP2C19-inhibitor: | 0.175 | CYP2C19-substrate: | 0.939 |
CYP2C9-inhibitor: | 0.202 | CYP2C9-substrate: | 0.298 |
CYP2D6-inhibitor: | 0.018 | CYP2D6-substrate: | 0.636 |
CYP3A4-inhibitor: | 0.551 | CYP3A4-substrate: | 0.702 |
Clearance (CL): | 5.476 | Half-life (T1/2): | 0.231 |
hERG Blockers: | 0.4 | Human Hepatotoxicity (H-HT): | 0.449 |
Drug-inuced Liver Injury (DILI): | 0.776 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.098 | Maximum Recommended Daily Dose: | 0.046 |
Skin Sensitization: | 0.821 | Carcinogencity: | 0.015 |
Eye Corrosion: | 0.661 | Eye Irritation: | 0.522 |
Respiratory Toxicity: | 0.962 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001764 | ![]() |
0.647 | D0Y7LD | ![]() |
0.615 | ||
ENC002882 | ![]() |
0.647 | D04DJN | ![]() |
0.426 | ||
ENC005239 | ![]() |
0.647 | D0M4WA | ![]() |
0.380 | ||
ENC001008 | ![]() |
0.615 | D09NNA | ![]() |
0.377 | ||
ENC001107 | ![]() |
0.615 | D03ZTE | ![]() |
0.373 | ||
ENC001647 | ![]() |
0.586 | D0G3SH | ![]() |
0.373 | ||
ENC001170 | ![]() |
0.581 | D0K5WS | ![]() |
0.347 | ||
ENC000961 | ![]() |
0.514 | D08SVH | ![]() |
0.347 | ||
ENC000125 | ![]() |
0.482 | D07BSQ | ![]() |
0.342 | ||
ENC001769 | ![]() |
0.478 | D06XMU | ![]() |
0.333 |