|
Name |
Trichotetronine
|
Molecular Formula | C28H32O8 | |
IUPAC Name* |
(1R,3S,4S,7R,8S)-7-[(2E,4E)-hexa-2,4-dienoyl]-3-hydroxy-8-[(2R)-3-hydroxy-2,4-dimethyl-5-oxofuran-2-yl]-5-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-1,3-dimethylbicyclo[2.2.2]octane-2,6-dione
|
|
SMILES |
C/C=C/C=C/C(=O)[C@@H]1[C@H]([C@H]2C(=C(/C=C/C=C/C)O)C(=O)[C@@]1(C(=O)[C@@]2(C)O)C)[C@@]3(C(=C(C(=O)O3)C)O)C
|
|
InChI |
InChI=1S/C28H32O8/c1-7-9-11-13-16(29)18-20-21(28(6)22(31)15(3)24(33)36-28)19(17(30)14-12-10-8-2)26(4,23(18)32)25(34)27(20,5)35/h7-14,19-21,29,31,35H,1-6H3/b9-7+,10-8+,13-11+,14-12+,18-16?/t19-,20-,21-,26-,27+,28-/m1/s1
|
|
InChIKey |
POOKHYNGUAZJAE-XJZPPUTOSA-N
|
|
Synonyms |
Trichotetronine
|
|
CAS | NA | |
PubChem CID | 102329399 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 496.5 | ALogp: | 3.0 |
HBD: | 3 | HBA: | 8 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 138.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 36 | QED Weighted: | 0.163 |
Caco-2 Permeability: | -4.954 | MDCK Permeability: | 0.00007330 |
Pgp-inhibitor: | 0.997 | Pgp-substrate: | 0.051 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.903 | Plasma Protein Binding (PPB): | 85.15% |
Volume Distribution (VD): | 1.089 | Fu: | 8.99% |
CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.197 |
CYP2C19-inhibitor: | 0.021 | CYP2C19-substrate: | 0.743 |
CYP2C9-inhibitor: | 0.008 | CYP2C9-substrate: | 0.033 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.044 |
CYP3A4-inhibitor: | 0.901 | CYP3A4-substrate: | 0.913 |
Clearance (CL): | 6.167 | Half-life (T1/2): | 0.414 |
hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.105 |
Drug-inuced Liver Injury (DILI): | 0.592 | AMES Toxicity: | 0.039 |
Rat Oral Acute Toxicity: | 0.681 | Maximum Recommended Daily Dose: | 0.927 |
Skin Sensitization: | 0.654 | Carcinogencity: | 0.747 |
Eye Corrosion: | 0.615 | Eye Irritation: | 0.137 |
Respiratory Toxicity: | 0.953 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003579 | 0.776 | D0FG6M | 0.224 | ||||
ENC004085 | 0.667 | D0J2NK | 0.215 | ||||
ENC003128 | 0.583 | D0E9KA | 0.212 | ||||
ENC003500 | 0.532 | D05QDC | 0.205 | ||||
ENC004086 | 0.508 | D0G3PI | 0.203 | ||||
ENC003709 | 0.477 | D02DGU | 0.203 | ||||
ENC005987 | 0.447 | D00DKK | 0.203 | ||||
ENC004472 | 0.447 | D08NQZ | 0.201 | ||||
ENC002144 | 0.444 | D0R6RC | 0.199 | ||||
ENC003887 | 0.440 | D02GAC | 0.191 |