![]() |
Name |
(1R,4S,5S,8S,10S,13R)-4,8,13,15,15-pentamethyltetracyclo[6.5.1.11,10.05,14]pentadecan-4-ol
|
Molecular Formula | C20H34O | |
IUPAC Name* |
(1R,4S,5S,8S,10S,13R)-4,8,13,15,15-pentamethyltetracyclo[6.5.1.11,10.05,14]pentadecan-4-ol
|
|
SMILES |
C[C@@H]1CC[C@H]2C[C@@]3(CC[C@H]4C3[C@@]1(C2(C)C)CC[C@]4(C)O)C
|
|
InChI |
InChI=1S/C20H34O/c1-13-6-7-14-12-18(4)9-8-15-16(18)20(13,17(14,2)3)11-10-19(15,5)21/h13-16,21H,6-12H2,1-5H3/t13-,14+,15+,16?,18+,19+,20-/m1/s1
|
|
InChIKey |
RLFWGQVIKYIGGM-RSMOHBFXSA-N
|
|
Synonyms |
Wickerol A
|
|
CAS | NA | |
PubChem CID | 102026162 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 290.5 | ALogp: | 5.6 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 4 |
Heavy Atoms: | 21 | QED Weighted: | 0.636 |
Caco-2 Permeability: | -4.795 | MDCK Permeability: | 0.00001770 |
Pgp-inhibitor: | 0.945 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.391 |
30% Bioavailability (F30%): | 0.932 |
Blood-Brain-Barrier Penetration (BBB): | 0.245 | Plasma Protein Binding (PPB): | 93.21% |
Volume Distribution (VD): | 1.117 | Fu: | 6.02% |
CYP1A2-inhibitor: | 0.106 | CYP1A2-substrate: | 0.301 |
CYP2C19-inhibitor: | 0.215 | CYP2C19-substrate: | 0.931 |
CYP2C9-inhibitor: | 0.298 | CYP2C9-substrate: | 0.293 |
CYP2D6-inhibitor: | 0.24 | CYP2D6-substrate: | 0.338 |
CYP3A4-inhibitor: | 0.89 | CYP3A4-substrate: | 0.492 |
Clearance (CL): | 14.514 | Half-life (T1/2): | 0.056 |
hERG Blockers: | 0.125 | Human Hepatotoxicity (H-HT): | 0.251 |
Drug-inuced Liver Injury (DILI): | 0.038 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.099 | Maximum Recommended Daily Dose: | 0.859 |
Skin Sensitization: | 0.892 | Carcinogencity: | 0.242 |
Eye Corrosion: | 0.642 | Eye Irritation: | 0.45 |
Respiratory Toxicity: | 0.97 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004227 | ![]() |
0.629 | D0U3GL | ![]() |
0.356 | ||
ENC006063 | ![]() |
0.629 | D0Q6NZ | ![]() |
0.337 | ||
ENC004411 | ![]() |
0.487 | D08QKJ | ![]() |
0.330 | ||
ENC004410 | ![]() |
0.468 | D0Z1XD | ![]() |
0.326 | ||
ENC004409 | ![]() |
0.450 | D0I2SD | ![]() |
0.316 | ||
ENC001893 | ![]() |
0.429 | D0L2LS | ![]() |
0.312 | ||
ENC002608 | ![]() |
0.420 | D04DJN | ![]() |
0.303 | ||
ENC002099 | ![]() |
0.415 | D00VZZ | ![]() |
0.301 | ||
ENC006062 | ![]() |
0.390 | D09NNA | ![]() |
0.290 | ||
ENC001172 | ![]() |
0.389 | D04GJN | ![]() |
0.276 |