![]() |
Name |
Lysofungin
|
Molecular Formula | C27H49O12P | |
IUPAC Name* |
[(2R)-2-hydroxy-3-[hydroxy-[(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (9E,12E)-octadeca-9,12-dienoate
|
|
SMILES |
CCCCC/C=C/C/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC1[C@@H]([C@H](C([C@H]([C@H]1O)O)O)O)O)O
|
|
InChI |
InChI=1S/C27H49O12P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(29)37-18-20(28)19-38-40(35,36)39-27-25(33)23(31)22(30)24(32)26(27)34/h6-7,9-10,20,22-28,30-34H,2-5,8,11-19H2,1H3,(H,35,36)/b7-6+,10-9+/t20-,22?,23-,24+,25-,26-,27?/m1/s1
|
|
InChIKey |
SAHCQBPGXQFTRA-ONKXREAUSA-N
|
|
Synonyms |
Lysofungin
|
|
CAS | NA | |
PubChem CID | 101628721 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 596.6 | ALogp: | 1.8 |
HBD: | 7 | HBA: | 12 |
Rotatable Bonds: | 22 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 203.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 40 | QED Weighted: | 0.044 |
Caco-2 Permeability: | -5.776 | MDCK Permeability: | 0.00005630 |
Pgp-inhibitor: | 0.665 | Pgp-substrate: | 0.981 |
Human Intestinal Absorption (HIA): | 0.941 | 20% Bioavailability (F20%): | 0.998 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.09 | Plasma Protein Binding (PPB): | 98.28% |
Volume Distribution (VD): | 0.611 | Fu: | 1.16% |
CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.031 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.057 |
CYP2C9-inhibitor: | 0.008 | CYP2C9-substrate: | 0.984 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.078 |
CYP3A4-inhibitor: | 0.028 | CYP3A4-substrate: | 0.004 |
Clearance (CL): | 1.054 | Half-life (T1/2): | 0.906 |
hERG Blockers: | 0.215 | Human Hepatotoxicity (H-HT): | 0.513 |
Drug-inuced Liver Injury (DILI): | 0.008 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.011 | Maximum Recommended Daily Dose: | 0.944 |
Skin Sensitization: | 0.916 | Carcinogencity: | 0.267 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.014 |
Respiratory Toxicity: | 0.776 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001930 | ![]() |
0.509 | D0O1TC | ![]() |
0.418 | ||
ENC001583 | ![]() |
0.504 | D0OR6A | ![]() |
0.384 | ||
ENC001715 | ![]() |
0.496 | D0O1PH | ![]() |
0.375 | ||
ENC001845 | ![]() |
0.492 | D0UE9X | ![]() |
0.369 | ||
ENC001700 | ![]() |
0.484 | D0H2YX | ![]() |
0.340 | ||
ENC001714 | ![]() |
0.479 | D09SRR | ![]() |
0.331 | ||
ENC001711 | ![]() |
0.479 | D00MLW | ![]() |
0.311 | ||
ENC001660 | ![]() |
0.478 | D04RGA | ![]() |
0.309 | ||
ENC001605 | ![]() |
0.478 | D07PCI | ![]() |
0.288 | ||
ENC001535 | ![]() |
0.465 | D0I4DQ | ![]() |
0.288 |