![]() |
Name |
(3S)-3-[[(3R)-7,7-dimethyl-3-(2-methylbut-3-en-2-yl)-2-oxo-1H-pyrano[2,3-g]indol-3-yl]methyl]-8a-hydroxy-3,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione
|
Molecular Formula | C26H31N3O5 | |
IUPAC Name* |
(3S)-3-[[(3R)-7,7-dimethyl-3-(2-methylbut-3-en-2-yl)-2-oxo-1H-pyrano[2,3-g]indol-3-yl]methyl]-8a-hydroxy-3,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione
|
|
SMILES |
CC1(C=CC2=C(O1)C=CC3=C2NC(=O)[C@]3(C[C@H]4C(=O)N5CCCC5(C(=O)N4)O)C(C)(C)C=C)C
|
|
InChI |
InChI=1S/C26H31N3O5/c1-6-23(2,3)25(14-17-20(30)29-13-7-11-26(29,33)22(32)27-17)16-8-9-18-15(19(16)28-21(25)31)10-12-24(4,5)34-18/h6,8-10,12,17,33H,1,7,11,13-14H2,2-5H3,(H,27,32)(H,28,31)/t17-,25+,26?/m0/s1
|
|
InChIKey |
GRGBTCMGCXJTOO-OQKZOFOUSA-N
|
|
Synonyms |
Notoamide M
|
|
CAS | NA | |
PubChem CID | 101463299 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 465.5 | ALogp: | 2.3 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 108.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 34 | QED Weighted: | 0.592 |
Caco-2 Permeability: | -4.906 | MDCK Permeability: | 0.00002460 |
Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.2 | 20% Bioavailability (F20%): | 0.079 |
30% Bioavailability (F30%): | 0.039 |
Blood-Brain-Barrier Penetration (BBB): | 0.518 | Plasma Protein Binding (PPB): | 90.99% |
Volume Distribution (VD): | 0.875 | Fu: | 7.98% |
CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.305 |
CYP2C19-inhibitor: | 0.178 | CYP2C19-substrate: | 0.856 |
CYP2C9-inhibitor: | 0.645 | CYP2C9-substrate: | 0.658 |
CYP2D6-inhibitor: | 0.447 | CYP2D6-substrate: | 0.141 |
CYP3A4-inhibitor: | 0.943 | CYP3A4-substrate: | 0.934 |
Clearance (CL): | 2.189 | Half-life (T1/2): | 0.29 |
hERG Blockers: | 0.023 | Human Hepatotoxicity (H-HT): | 0.134 |
Drug-inuced Liver Injury (DILI): | 0.437 | AMES Toxicity: | 0.031 |
Rat Oral Acute Toxicity: | 0.907 | Maximum Recommended Daily Dose: | 0.897 |
Skin Sensitization: | 0.042 | Carcinogencity: | 0.958 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
Respiratory Toxicity: | 0.306 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002535 | ![]() |
0.736 | D06XZW | ![]() |
0.226 | ||
ENC004604 | ![]() |
0.551 | D02IQY | ![]() |
0.225 | ||
ENC002052 | ![]() |
0.520 | D06YFA | ![]() |
0.211 | ||
ENC002366 | ![]() |
0.516 | D05AFR | ![]() |
0.210 | ||
ENC002534 | ![]() |
0.516 | D0Y7RW | ![]() |
0.207 | ||
ENC002536 | ![]() |
0.516 | D0IL7L | ![]() |
0.206 | ||
ENC002365 | ![]() |
0.508 | D08UMH | ![]() |
0.203 | ||
ENC004071 | ![]() |
0.496 | D0I5DS | ![]() |
0.203 | ||
ENC004946 | ![]() |
0.477 | D06HBQ | ![]() |
0.202 | ||
ENC004947 | ![]() |
0.473 | D0X3FX | ![]() |
0.201 |