|
Name |
5,6-Epoxyergosterol
|
Molecular Formula | C28H44O2 | |
IUPAC Name* |
(1S,2R,5S,7R,9S,12R,15R,16R)-15-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-10-en-5-ol
|
|
SMILES |
C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2=C[C@H]4[C@@]5([C@@]3(CC[C@@H](C5)O)C)O4)C
|
|
InChI |
InChI=1S/C28H44O2/c1-17(2)18(3)7-8-19(4)22-9-10-23-21-15-25-28(30-25)16-20(29)11-14-27(28,6)24(21)12-13-26(22,23)5/h7-8,15,17-20,22-25,29H,9-14,16H2,1-6H3/b8-7+/t18-,19+,20-,22+,23-,24-,25-,26+,27+,28-/m0/s1
|
|
InChIKey |
KVMYKLHJBYIOKD-QYYFJRRUSA-N
|
|
Synonyms |
5,6-Epoxyergosterol; DTXSID301315685; (22E)-5alpha,6alpha-Epoxyergosta-7,22-diene-3beta-ol; 5alpha,6alpha-epoxy-24(R)-methylcholesta-7,22-dien-3beta-ol; (24R)-5,6alpha-Epoxy-24-methyl-5alpha-cholesta-7,22-diene-3beta-ol; 23637-31-2
|
|
CAS | 23637-31-2 | |
PubChem CID | 100938000 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 412.6 | ALogp: | 6.6 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 32.8 | Aromatic Rings: | 5 |
Heavy Atoms: | 30 | QED Weighted: | 0.422 |
Caco-2 Permeability: | -4.72 | MDCK Permeability: | 0.00003680 |
Pgp-inhibitor: | 0.469 | Pgp-substrate: | 0.908 |
Human Intestinal Absorption (HIA): | 0.035 | 20% Bioavailability (F20%): | 0.919 |
30% Bioavailability (F30%): | 0.883 |
Blood-Brain-Barrier Penetration (BBB): | 0.077 | Plasma Protein Binding (PPB): | 87.68% |
Volume Distribution (VD): | 1.162 | Fu: | 1.86% |
CYP1A2-inhibitor: | 0.067 | CYP1A2-substrate: | 0.763 |
CYP2C19-inhibitor: | 0.1 | CYP2C19-substrate: | 0.934 |
CYP2C9-inhibitor: | 0.316 | CYP2C9-substrate: | 0.047 |
CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.365 |
CYP3A4-inhibitor: | 0.846 | CYP3A4-substrate: | 0.851 |
Clearance (CL): | 3.542 | Half-life (T1/2): | 0.1 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.144 |
Drug-inuced Liver Injury (DILI): | 0.05 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.94 | Maximum Recommended Daily Dose: | 0.976 |
Skin Sensitization: | 0.07 | Carcinogencity: | 0.009 |
Eye Corrosion: | 0.017 | Eye Irritation: | 0.133 |
Respiratory Toxicity: | 0.969 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006034 | 1.000 | D0G8OC | 0.495 | ||||
ENC001984 | 0.777 | D06JPB | 0.455 | ||||
ENC005438 | 0.777 | D0G5CF | 0.447 | ||||
ENC004757 | 0.777 | D0Y7LD | 0.372 | ||||
ENC004804 | 0.777 | D0N1TP | 0.352 | ||||
ENC005016 | 0.667 | D01QUS | 0.339 | ||||
ENC004735 | 0.663 | D08SVH | 0.310 | ||||
ENC001092 | 0.646 | D0K5WS | 0.298 | ||||
ENC004738 | 0.646 | D03XOC | 0.293 | ||||
ENC005707 | 0.646 | D0B4RU | 0.289 |