![]() |
Name |
beta-Duprezianane
|
Molecular Formula | C15H24 | |
IUPAC Name* |
(1R,2R,5S,7S)-2,6,6-trimethyl-8-methylidenetricyclo[5.2.2.01,5]undecane
|
|
SMILES |
C[C@@H]1CC[C@@H]2[C@@]13CC[C@H](C2(C)C)C(=C)C3
|
|
InChI |
InChI=1S/C15H24/c1-10-9-15-8-7-12(10)14(3,4)13(15)6-5-11(15)2/h11-13H,1,5-9H2,2-4H3/t11-,12+,13+,15-/m1/s1
|
|
InChIKey |
SODGFMASLAAZRW-UKTARXLSSA-N
|
|
Synonyms |
beta-Duprezianane; .beta.-Duprezianene
|
|
CAS | NA | |
PubChem CID | 91750164 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 204.35 | ALogp: | 4.9 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 15 | QED Weighted: | 0.491 |
Caco-2 Permeability: | -4.585 | MDCK Permeability: | 0.00001490 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.917 |
30% Bioavailability (F30%): | 0.599 |
Blood-Brain-Barrier Penetration (BBB): | 0.658 | Plasma Protein Binding (PPB): | 79.12% |
Volume Distribution (VD): | 0.867 | Fu: | 19.10% |
CYP1A2-inhibitor: | 0.344 | CYP1A2-substrate: | 0.26 |
CYP2C19-inhibitor: | 0.272 | CYP2C19-substrate: | 0.811 |
CYP2C9-inhibitor: | 0.441 | CYP2C9-substrate: | 0.302 |
CYP2D6-inhibitor: | 0.03 | CYP2D6-substrate: | 0.597 |
CYP3A4-inhibitor: | 0.151 | CYP3A4-substrate: | 0.254 |
Clearance (CL): | 7.08 | Half-life (T1/2): | 0.061 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.146 |
Drug-inuced Liver Injury (DILI): | 0.051 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.433 | Maximum Recommended Daily Dose: | 0.957 |
Skin Sensitization: | 0.206 | Carcinogencity: | 0.127 |
Eye Corrosion: | 0.97 | Eye Irritation: | 0.971 |
Respiratory Toxicity: | 0.968 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002110 | ![]() |
0.673 | D04VIS | ![]() |
0.253 | ||
ENC003109 | ![]() |
0.673 | D0H1QY | ![]() |
0.250 | ||
ENC002998 | ![]() |
0.577 | D0Q6NZ | ![]() |
0.244 | ||
ENC003215 | ![]() |
0.519 | D0Z1XD | ![]() |
0.244 | ||
ENC001831 | ![]() |
0.519 | D0D2VS | ![]() |
0.244 | ||
ENC001893 | ![]() |
0.474 | D0U3GL | ![]() |
0.244 | ||
ENC003477 | ![]() |
0.474 | D0S3WH | ![]() |
0.244 | ||
ENC001172 | ![]() |
0.424 | D08QKJ | ![]() |
0.239 | ||
ENC002989 | ![]() |
0.414 | D0V8HA | ![]() |
0.237 | ||
ENC002267 | ![]() |
0.410 | D0B4RU | ![]() |
0.235 |