![]() |
Name |
(3R)-6,8-dihydroxy-3-[[(2R,6S)-5-hydroxy-6-methyloxan-2-yl]methyl]-3,4-dihydroisochromen-1-one
|
Molecular Formula | C16H20O6 | |
IUPAC Name* |
(3R)-6,8-dihydroxy-3-[[(2R,6S)-5-hydroxy-6-methyloxan-2-yl]methyl]-3,4-dihydroisochromen-1-one
|
|
SMILES |
C[C@H]1C(CC[C@@H](O1)C[C@H]2CC3=C(C(=CC(=C3)O)O)C(=O)O2)O
|
|
InChI |
InChI=1S/C16H20O6/c1-8-13(18)3-2-11(21-8)7-12-5-9-4-10(17)6-14(19)15(9)16(20)22-12/h4,6,8,11-13,17-19H,2-3,5,7H2,1H3/t8-,11+,12+,13?/m0/s1
|
|
InChIKey |
IEOXNDOOKTVJRQ-XRUQCVFWSA-N
|
|
Synonyms |
5'-Hydroxyasperentin; 38747-39-6
|
|
CAS | NA | |
PubChem CID | 90471937 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 308.33 | ALogp: | 2.3 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 96.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 22 | QED Weighted: | 0.723 |
Caco-2 Permeability: | -5.179 | MDCK Permeability: | 0.00001800 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.135 |
Human Intestinal Absorption (HIA): | 0.016 | 20% Bioavailability (F20%): | 0.012 |
30% Bioavailability (F30%): | 0.81 |
Blood-Brain-Barrier Penetration (BBB): | 0.313 | Plasma Protein Binding (PPB): | 77.05% |
Volume Distribution (VD): | 1.465 | Fu: | 14.66% |
CYP1A2-inhibitor: | 0.384 | CYP1A2-substrate: | 0.142 |
CYP2C19-inhibitor: | 0.043 | CYP2C19-substrate: | 0.134 |
CYP2C9-inhibitor: | 0.059 | CYP2C9-substrate: | 0.876 |
CYP2D6-inhibitor: | 0.235 | CYP2D6-substrate: | 0.23 |
CYP3A4-inhibitor: | 0.237 | CYP3A4-substrate: | 0.17 |
Clearance (CL): | 14.829 | Half-life (T1/2): | 0.744 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.678 |
Drug-inuced Liver Injury (DILI): | 0.836 | AMES Toxicity: | 0.363 |
Rat Oral Acute Toxicity: | 0.06 | Maximum Recommended Daily Dose: | 0.984 |
Skin Sensitization: | 0.804 | Carcinogencity: | 0.917 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.607 |
Respiratory Toxicity: | 0.699 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002956 | ![]() |
1.000 | D07MGA | ![]() |
0.298 | ||
ENC002947 | ![]() |
0.739 | D0Z1FX | ![]() |
0.263 | ||
ENC002270 | ![]() |
0.739 | D0AZ8C | ![]() |
0.252 | ||
ENC003280 | ![]() |
0.739 | D01KQA | ![]() |
0.250 | ||
ENC003297 | ![]() |
0.718 | D03YVO | ![]() |
0.250 | ||
ENC002946 | ![]() |
0.577 | D04JHN | ![]() |
0.247 | ||
ENC005476 | ![]() |
0.577 | D0PG8O | ![]() |
0.245 | ||
ENC005477 | ![]() |
0.551 | D03DXN | ![]() |
0.243 | ||
ENC003244 | ![]() |
0.526 | D08QMX | ![]() |
0.242 | ||
ENC005249 | ![]() |
0.523 | D00ZFP | ![]() |
0.242 |