![]() |
Name |
Ophiobolin Q
|
Molecular Formula | C25H36O4 | |
IUPAC Name* |
(1R,3S,7R,8E,11S,12R)-12-[(Z,2S,5S)-5,6-dihydroxy-6-methylhept-3-en-2-yl]-1,4-dimethyl-6-oxotricyclo[9.3.0.03,7]tetradeca-4,8-diene-8-carbaldehyde
|
|
SMILES |
CC1=CC(=O)[C@@H]/2[C@@H]1C[C@]3(CC[C@@H]([C@@H]3C/C=C2/C=O)[C@@H](C)/C=C\[C@@H](C(C)(C)O)O)C
|
|
InChI |
InChI=1S/C25H36O4/c1-15(6-9-22(28)24(3,4)29)18-10-11-25(5)13-19-16(2)12-21(27)23(19)17(14-26)7-8-20(18)25/h6-7,9,12,14-15,18-20,22-23,28-29H,8,10-11,13H2,1-5H3/b9-6-,17-7-/t15-,18+,19+,20-,22-,23-,25+/m0/s1
|
|
InChIKey |
ZCYAUPOUCSSQGA-WBBAMFPJSA-N
|
|
Synonyms |
CHEMBL4550481; Ophiobolin Q; BDBM50523063
|
|
CAS | NA | |
PubChem CID | 73386894 | |
ChEMBL ID | CHEMBL4550481 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 400.5 | ALogp: | 3.3 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 74.6 | Aromatic Rings: | 3 |
Heavy Atoms: | 29 | QED Weighted: | 0.52 |
Caco-2 Permeability: | -4.747 | MDCK Permeability: | 0.00002820 |
Pgp-inhibitor: | 0.111 | Pgp-substrate: | 0.947 |
Human Intestinal Absorption (HIA): | 0.878 | 20% Bioavailability (F20%): | 0.992 |
30% Bioavailability (F30%): | 0.073 |
Blood-Brain-Barrier Penetration (BBB): | 0.4 | Plasma Protein Binding (PPB): | 83.30% |
Volume Distribution (VD): | 1.064 | Fu: | 5.61% |
CYP1A2-inhibitor: | 0.016 | CYP1A2-substrate: | 0.158 |
CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.796 |
CYP2C9-inhibitor: | 0.075 | CYP2C9-substrate: | 0.352 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.105 |
CYP3A4-inhibitor: | 0.755 | CYP3A4-substrate: | 0.642 |
Clearance (CL): | 6.123 | Half-life (T1/2): | 0.477 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.145 |
Drug-inuced Liver Injury (DILI): | 0.299 | AMES Toxicity: | 0.049 |
Rat Oral Acute Toxicity: | 0.903 | Maximum Recommended Daily Dose: | 0.958 |
Skin Sensitization: | 0.822 | Carcinogencity: | 0.529 |
Eye Corrosion: | 0.055 | Eye Irritation: | 0.02 |
Respiratory Toxicity: | 0.987 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003777 | ![]() |
0.828 | D0N1TP | ![]() |
0.290 | ||
ENC003251 | ![]() |
0.708 | D0G5CF | ![]() |
0.250 | ||
ENC003687 | ![]() |
0.594 | D02ZGI | ![]() |
0.240 | ||
ENC005803 | ![]() |
0.583 | D0G8OC | ![]() |
0.234 | ||
ENC002982 | ![]() |
0.582 | D06JPB | ![]() |
0.234 | ||
ENC005044 | ![]() |
0.571 | D06AEO | ![]() |
0.231 | ||
ENC005045 | ![]() |
0.524 | D0P0HT | ![]() |
0.230 | ||
ENC002000 | ![]() |
0.495 | D01QUS | ![]() |
0.229 | ||
ENC003783 | ![]() |
0.495 | D04GJN | ![]() |
0.227 | ||
ENC005046 | ![]() |
0.413 | D0V2JK | ![]() |
0.226 |