![]() |
Name |
6,8-Dihydroxyisocoumarin-3-carboxylic acid
|
Molecular Formula | C10H6O6 | |
IUPAC Name* |
6,8-dihydroxy-1-oxoisochromene-3-carboxylic acid
|
|
SMILES |
C1=C2C=C(OC(=O)C2=C(C=C1O)O)C(=O)O
|
|
InChI |
InChI=1S/C10H6O6/c11-5-1-4-2-7(9(13)14)16-10(15)8(4)6(12)3-5/h1-3,11-12H,(H,13,14)
|
|
InChIKey |
GWMILDFJBMOCEW-UHFFFAOYSA-N
|
|
Synonyms |
6,8-dihydroxyisocoumarin-3-carboxylic acid; 6,8-Dihydroxy-1-oxo-1H-2-benzopyran-3-carboxylic acid
|
|
CAS | NA | |
PubChem CID | 71552030 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 222.15 | ALogp: | 1.5 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 104.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 16 | QED Weighted: | 0.671 |
Caco-2 Permeability: | -4.992 | MDCK Permeability: | 0.00001150 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.789 |
Human Intestinal Absorption (HIA): | 0.073 | 20% Bioavailability (F20%): | 0.951 |
30% Bioavailability (F30%): | 0.999 |
Blood-Brain-Barrier Penetration (BBB): | 0.054 | Plasma Protein Binding (PPB): | 80.07% |
Volume Distribution (VD): | 0.536 | Fu: | 24.30% |
CYP1A2-inhibitor: | 0.229 | CYP1A2-substrate: | 0.087 |
CYP2C19-inhibitor: | 0.034 | CYP2C19-substrate: | 0.041 |
CYP2C9-inhibitor: | 0.239 | CYP2C9-substrate: | 0.289 |
CYP2D6-inhibitor: | 0.023 | CYP2D6-substrate: | 0.135 |
CYP3A4-inhibitor: | 0.056 | CYP3A4-substrate: | 0.023 |
Clearance (CL): | 2.05 | Half-life (T1/2): | 0.945 |
hERG Blockers: | 0.025 | Human Hepatotoxicity (H-HT): | 0.078 |
Drug-inuced Liver Injury (DILI): | 0.956 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.019 | Maximum Recommended Daily Dose: | 0.057 |
Skin Sensitization: | 0.521 | Carcinogencity: | 0.046 |
Eye Corrosion: | 0.218 | Eye Irritation: | 0.954 |
Respiratory Toxicity: | 0.471 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005346 | ![]() |
0.724 | D04AIT | ![]() |
0.365 | ||
ENC005370 | ![]() |
0.653 | D0K8KX | ![]() |
0.355 | ||
ENC001542 | ![]() |
0.653 | D07EXH | ![]() |
0.314 | ||
ENC004676 | ![]() |
0.653 | D07MGA | ![]() |
0.300 | ||
ENC001951 | ![]() |
0.647 | D06FVX | ![]() |
0.289 | ||
ENC004995 | ![]() |
0.590 | D00KRE | ![]() |
0.288 | ||
ENC002320 | ![]() |
0.590 | D0C4YC | ![]() |
0.286 | ||
ENC004556 | ![]() |
0.589 | D01WJL | ![]() |
0.286 | ||
ENC001569 | ![]() |
0.589 | D0V9EN | ![]() |
0.279 | ||
ENC005110 | ![]() |
0.569 | D08LFZ | ![]() |
0.278 |