![]() |
Name |
Acremonide
|
Molecular Formula | C12H12O4 | |
IUPAC Name* |
5,7-dimethoxy-4-methyl-3-methylidene-2-benzofuran-1-one
|
|
SMILES |
CC1=C2C(=C)OC(=O)C2=C(C=C1OC)OC
|
|
InChI |
InChI=1S/C12H12O4/c1-6-8(14-3)5-9(15-4)11-10(6)7(2)16-12(11)13/h5H,2H2,1,3-4H3
|
|
InChIKey |
NXGVLVFLPDSCCW-UHFFFAOYSA-N
|
|
Synonyms |
Acremonide; CHEMBL2047178; 5,7-dimethoxy-4-methyl-3-methylene-isobenzofuran-1-one
|
|
CAS | NA | |
PubChem CID | 59053257 | |
ChEMBL ID | CHEMBL2047178 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 220.22 | ALogp: | 2.3 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 44.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 16 | QED Weighted: | 0.719 |
Caco-2 Permeability: | -4.732 | MDCK Permeability: | 0.00002420 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.202 |
30% Bioavailability (F30%): | 0.012 |
Blood-Brain-Barrier Penetration (BBB): | 0.843 | Plasma Protein Binding (PPB): | 82.34% |
Volume Distribution (VD): | 1.42 | Fu: | 17.45% |
CYP1A2-inhibitor: | 0.886 | CYP1A2-substrate: | 0.932 |
CYP2C19-inhibitor: | 0.169 | CYP2C19-substrate: | 0.737 |
CYP2C9-inhibitor: | 0.127 | CYP2C9-substrate: | 0.844 |
CYP2D6-inhibitor: | 0.023 | CYP2D6-substrate: | 0.822 |
CYP3A4-inhibitor: | 0.131 | CYP3A4-substrate: | 0.188 |
Clearance (CL): | 9.206 | Half-life (T1/2): | 0.577 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.046 |
Drug-inuced Liver Injury (DILI): | 0.246 | AMES Toxicity: | 0.089 |
Rat Oral Acute Toxicity: | 0.879 | Maximum Recommended Daily Dose: | 0.077 |
Skin Sensitization: | 0.619 | Carcinogencity: | 0.068 |
Eye Corrosion: | 0.537 | Eye Irritation: | 0.972 |
Respiratory Toxicity: | 0.776 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004498 | ![]() |
0.544 | D0C1SF | ![]() |
0.350 | ||
ENC004499 | ![]() |
0.517 | D0G4KG | ![]() |
0.297 | ||
ENC004500 | ![]() |
0.517 | D06GCK | ![]() |
0.287 | ||
ENC004296 | ![]() |
0.500 | D0AO5H | ![]() |
0.278 | ||
ENC004501 | ![]() |
0.477 | D06QKV | ![]() |
0.273 | ||
ENC005163 | ![]() |
0.458 | D02LZB | ![]() |
0.269 | ||
ENC001379 | ![]() |
0.439 | D0F7CS | ![]() |
0.263 | ||
ENC004503 | ![]() |
0.426 | D09PJX | ![]() |
0.259 | ||
ENC004992 | ![]() |
0.422 | D0Y7TS | ![]() |
0.255 | ||
ENC005907 | ![]() |
0.422 | D0L1JW | ![]() |
0.255 |