![]() |
Name |
7-Epi-sesquithujene
|
Molecular Formula | C15H24 | |
IUPAC Name* |
(1S)-2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]bicyclo[3.1.0]hex-2-ene
|
|
SMILES |
CC1=CC[C@@]2([C@H]1C2)[C@H](C)CCC=C(C)C
|
|
InChI |
InChI=1S/C15H24/c1-11(2)6-5-7-13(4)15-9-8-12(3)14(15)10-15/h6,8,13-14H,5,7,9-10H2,1-4H3/t13-,14+,15+/m1/s1
|
|
InChIKey |
UCQHFDKBUHCAFR-ILXRZTDVSA-N
|
|
Synonyms |
7-epi-sesquithujene; (+)-7-epi-sesquithujene; sesquithujene; (1S,5R)-2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]bicyclo[3.1.0]hex-2-ene; CHEBI:63710; C20177; Q27132748
|
|
CAS | NA | |
PubChem CID | 56927990 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 204.35 | ALogp: | 4.8 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 15 | QED Weighted: | 0.555 |
Caco-2 Permeability: | -4.492 | MDCK Permeability: | 0.00001930 |
Pgp-inhibitor: | 0.024 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.967 |
30% Bioavailability (F30%): | 0.981 |
Blood-Brain-Barrier Penetration (BBB): | 0.104 | Plasma Protein Binding (PPB): | 94.81% |
Volume Distribution (VD): | 4.319 | Fu: | 3.76% |
CYP1A2-inhibitor: | 0.876 | CYP1A2-substrate: | 0.273 |
CYP2C19-inhibitor: | 0.73 | CYP2C19-substrate: | 0.844 |
CYP2C9-inhibitor: | 0.575 | CYP2C9-substrate: | 0.73 |
CYP2D6-inhibitor: | 0.173 | CYP2D6-substrate: | 0.359 |
CYP3A4-inhibitor: | 0.602 | CYP3A4-substrate: | 0.239 |
Clearance (CL): | 13.314 | Half-life (T1/2): | 0.109 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.804 |
Drug-inuced Liver Injury (DILI): | 0.046 | AMES Toxicity: | 0.003 |
Rat Oral Acute Toxicity: | 0.024 | Maximum Recommended Daily Dose: | 0.069 |
Skin Sensitization: | 0.886 | Carcinogencity: | 0.044 |
Eye Corrosion: | 0.951 | Eye Irritation: | 0.987 |
Respiratory Toxicity: | 0.176 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000520 | ![]() |
0.511 | D0M1PQ | ![]() |
0.396 | ||
ENC000770 | ![]() |
0.464 | D0W6DG | ![]() |
0.222 | ||
ENC001827 | ![]() |
0.464 | D03VFL | ![]() |
0.202 | ||
ENC002218 | ![]() |
0.414 | D0X7XG | ![]() |
0.186 | ||
ENC002234 | ![]() |
0.390 | D0S7WX | ![]() |
0.181 | ||
ENC000796 | ![]() |
0.367 | D05XQE | ![]() |
0.174 | ||
ENC001455 | ![]() |
0.355 | D0A2AJ | ![]() |
0.167 | ||
ENC000804 | ![]() |
0.355 | D09XWD | ![]() |
0.165 | ||
ENC000311 | ![]() |
0.346 | D0K5WS | ![]() |
0.155 | ||
ENC000230 | ![]() |
0.346 | D07VFD | ![]() |
0.155 |