![]() |
Name |
11-Epi-Chaetomugilin I
|
Molecular Formula | C22H27ClO5 | |
IUPAC Name* |
(7S,8S)-5-chloro-7-hydroxy-3-[(E,3S,4R)-4-hydroxy-3-methylpent-1-enyl]-7-methyl-8-[(E)-3-methyl-2-oxopent-3-enyl]-8H-isochromen-6-one
|
|
SMILES |
C/C=C(\C)/C(=O)C[C@H]1C2=COC(=CC2=C(C(=O)[C@@]1(C)O)Cl)/C=C/[C@H](C)[C@@H](C)O
|
|
InChI |
InChI=1S/C22H27ClO5/c1-6-12(2)19(25)10-18-17-11-28-15(8-7-13(3)14(4)24)9-16(17)20(23)21(26)22(18,5)27/h6-9,11,13-14,18,24,27H,10H2,1-5H3/b8-7+,12-6+/t13-,14+,18-,22-/m0/s1
|
|
InChIKey |
BYFBAJVBSPNIFS-FLPRNSHASA-N
|
|
Synonyms |
11-Epi-Chaetomugilin I; CHEMBL1797232; HY-N10206; CS-0372707
|
|
CAS | NA | |
PubChem CID | 53358201 | |
ChEMBL ID | CHEMBL1797232 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 406.9 | ALogp: | 2.4 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 83.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 28 | QED Weighted: | 0.638 |
Caco-2 Permeability: | -4.554 | MDCK Permeability: | 0.00002100 |
Pgp-inhibitor: | 0.03 | Pgp-substrate: | 0.007 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.012 |
30% Bioavailability (F30%): | 0.024 |
Blood-Brain-Barrier Penetration (BBB): | 0.938 | Plasma Protein Binding (PPB): | 77.55% |
Volume Distribution (VD): | 1.626 | Fu: | 13.67% |
CYP1A2-inhibitor: | 0.897 | CYP1A2-substrate: | 0.517 |
CYP2C19-inhibitor: | 0.801 | CYP2C19-substrate: | 0.781 |
CYP2C9-inhibitor: | 0.687 | CYP2C9-substrate: | 0.069 |
CYP2D6-inhibitor: | 0.861 | CYP2D6-substrate: | 0.027 |
CYP3A4-inhibitor: | 0.92 | CYP3A4-substrate: | 0.485 |
Clearance (CL): | 3.604 | Half-life (T1/2): | 0.36 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.908 |
Drug-inuced Liver Injury (DILI): | 0.402 | AMES Toxicity: | 0.036 |
Rat Oral Acute Toxicity: | 0.934 | Maximum Recommended Daily Dose: | 0.919 |
Skin Sensitization: | 0.915 | Carcinogencity: | 0.955 |
Eye Corrosion: | 0.009 | Eye Irritation: | 0.107 |
Respiratory Toxicity: | 0.983 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002610 | ![]() |
1.000 | D0E9KA | ![]() |
0.228 | ||
ENC002612 | ![]() |
0.802 | D0JE2E | ![]() |
0.200 | ||
ENC002777 | ![]() |
0.724 | D0L5FY | ![]() |
0.200 | ||
ENC005844 | ![]() |
0.663 | D03KIA | ![]() |
0.199 | ||
ENC005878 | ![]() |
0.663 | D0HD9K | ![]() |
0.188 | ||
ENC002611 | ![]() |
0.638 | D06REO | ![]() |
0.188 | ||
ENC002178 | ![]() |
0.604 | D02GAC | ![]() |
0.186 | ||
ENC005437 | ![]() |
0.591 | D0R6RC | ![]() |
0.185 | ||
ENC002613 | ![]() |
0.520 | D01MML | ![]() |
0.184 | ||
ENC001876 | ![]() |
0.516 | D01CKY | ![]() |
0.182 |