![]() |
Name |
Prenylcandidusin B
|
Molecular Formula | C27H28O6 | |
IUPAC Name* |
2-(3-methylbut-2-enyl)-4-(1,4,7,8-tetramethoxydibenzofuran-3-yl)phenol
|
|
SMILES |
CC(=CCC1=C(C=CC(=C1)C2=CC(=C3C4=CC(=C(C=C4OC3=C2OC)OC)OC)OC)O)C
|
|
InChI |
InChI=1S/C27H28O6/c1-15(2)7-8-17-11-16(9-10-20(17)28)18-12-24(31-5)25-19-13-22(29-3)23(30-4)14-21(19)33-27(25)26(18)32-6/h7,9-14,28H,8H2,1-6H3
|
|
InChIKey |
JIAZRMIMWOXXHE-UHFFFAOYSA-N
|
|
Synonyms |
Prenylcandidusin B; CHEBI:67531; CHEMBL1795462; DTXSID401315983; Q27136000; 2-(3-methylbut-2-en-1-yl)-4-(1,4,7,8-tetramethoxydibenzo[b,d]furan-3-yl)phenol; 1297472-19-5
|
|
CAS | 1297472-19-5 | |
PubChem CID | 53262877 | |
ChEMBL ID | CHEMBL1795462 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 448.5 | ALogp: | 6.7 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 70.3 | Aromatic Rings: | 4 |
Heavy Atoms: | 33 | QED Weighted: | 0.327 |
Caco-2 Permeability: | -4.974 | MDCK Permeability: | 0.00002620 |
Pgp-inhibitor: | 0.977 | Pgp-substrate: | 0.01 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.099 |
Blood-Brain-Barrier Penetration (BBB): | 0.012 | Plasma Protein Binding (PPB): | 75.87% |
Volume Distribution (VD): | 0.522 | Fu: | 23.59% |
CYP1A2-inhibitor: | 0.355 | CYP1A2-substrate: | 0.973 |
CYP2C19-inhibitor: | 0.876 | CYP2C19-substrate: | 0.516 |
CYP2C9-inhibitor: | 0.848 | CYP2C9-substrate: | 0.939 |
CYP2D6-inhibitor: | 0.039 | CYP2D6-substrate: | 0.94 |
CYP3A4-inhibitor: | 0.341 | CYP3A4-substrate: | 0.536 |
Clearance (CL): | 10.87 | Half-life (T1/2): | 0.285 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.486 |
Drug-inuced Liver Injury (DILI): | 0.939 | AMES Toxicity: | 0.368 |
Rat Oral Acute Toxicity: | 0.078 | Maximum Recommended Daily Dose: | 0.639 |
Skin Sensitization: | 0.319 | Carcinogencity: | 0.066 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.166 |
Respiratory Toxicity: | 0.519 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002772 | ![]() |
0.847 | D06GCK | ![]() |
0.425 | ||
ENC005880 | ![]() |
0.693 | D0NJ3V | ![]() |
0.393 | ||
ENC005879 | ![]() |
0.693 | D01FFA | ![]() |
0.339 | ||
ENC002471 | ![]() |
0.546 | D09DHY | ![]() |
0.333 | ||
ENC005867 | ![]() |
0.534 | D02LZB | ![]() |
0.325 | ||
ENC002758 | ![]() |
0.526 | D0Q0PR | ![]() |
0.319 | ||
ENC002776 | ![]() |
0.509 | D0Y7TS | ![]() |
0.315 | ||
ENC005868 | ![]() |
0.508 | D0R0FE | ![]() |
0.307 | ||
ENC002475 | ![]() |
0.500 | D0W7JZ | ![]() |
0.307 | ||
ENC002452 | ![]() |
0.496 | D0A8FB | ![]() |
0.298 |