|
Name |
(+)-Microdiplodiasone
|
Molecular Formula | C14H14O6 | |
IUPAC Name* |
(2R)-5,7-dihydroxy-2-methyl-2-[(2R)-5-oxooxolan-2-yl]-3H-chromen-4-one
|
|
SMILES |
C[C@@]1(CC(=O)C2=C(C=C(C=C2O1)O)O)[C@H]3CCC(=O)O3
|
|
InChI |
InChI=1S/C14H14O6/c1-14(11-2-3-12(18)19-11)6-9(17)13-8(16)4-7(15)5-10(13)20-14/h4-5,11,15-16H,2-3,6H2,1H3/t11-,14-/m1/s1
|
|
InChIKey |
KYUNATJAFQPBJE-BXUZGUMPSA-N
|
|
Synonyms |
Microdiplodiasone; (+)-microdiplodiasone; CHEBI:68284; CHEMBL1765410; (2R,9R)-(+)-microdiplodiasone; Q27136778; (2R)-5,7-dihydroxy-2-methyl-2-[(2R)-5-oxotetrahydrofuran-2-yl]-2,3-dihydro-4H-chromen-4-one
|
|
CAS | NA | |
PubChem CID | 52937071 | |
ChEMBL ID | CHEMBL1765410 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 278.26 | ALogp: | 1.5 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 93.1 | Aromatic Rings: | 3 |
Heavy Atoms: | 20 | QED Weighted: | 0.764 |
Caco-2 Permeability: | -4.92 | MDCK Permeability: | 0.00000734 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.428 |
Human Intestinal Absorption (HIA): | 0.024 | 20% Bioavailability (F20%): | 0.707 |
30% Bioavailability (F30%): | 0.828 |
Blood-Brain-Barrier Penetration (BBB): | 0.273 | Plasma Protein Binding (PPB): | 71.62% |
Volume Distribution (VD): | 0.821 | Fu: | 29.03% |
CYP1A2-inhibitor: | 0.728 | CYP1A2-substrate: | 0.23 |
CYP2C19-inhibitor: | 0.271 | CYP2C19-substrate: | 0.061 |
CYP2C9-inhibitor: | 0.36 | CYP2C9-substrate: | 0.875 |
CYP2D6-inhibitor: | 0.574 | CYP2D6-substrate: | 0.408 |
CYP3A4-inhibitor: | 0.647 | CYP3A4-substrate: | 0.195 |
Clearance (CL): | 8.768 | Half-life (T1/2): | 0.853 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.244 |
Drug-inuced Liver Injury (DILI): | 0.912 | AMES Toxicity: | 0.089 |
Rat Oral Acute Toxicity: | 0.158 | Maximum Recommended Daily Dose: | 0.517 |
Skin Sensitization: | 0.163 | Carcinogencity: | 0.434 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.062 |
Respiratory Toxicity: | 0.252 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001430 | 0.449 | D07MGA | 0.365 | ||||
ENC003140 | 0.430 | D0L7AS | 0.252 | ||||
ENC005138 | 0.420 | D0C7JF | 0.245 | ||||
ENC000974 | 0.420 | D0P1FO | 0.240 | ||||
ENC005644 | 0.420 | D04JHN | 0.237 | ||||
ENC003031 | 0.418 | D0AZ8C | 0.234 | ||||
ENC003117 | 0.415 | D02NSF | 0.232 | ||||
ENC005643 | 0.413 | D00ZFP | 0.231 | ||||
ENC002287 | 0.413 | D04AIT | 0.228 | ||||
ENC002286 | 0.413 | D0K7LU | 0.224 |