![]() |
Name |
4,8-Dihydroxy-6-methoxy-3-methyl-3,4-dihydro-1h-isochromen-1-one
|
Molecular Formula | C11H12O5 | |
IUPAC Name* |
4,8-dihydroxy-6-methoxy-3-methyl-3,4-dihydroisochromen-1-one
|
|
SMILES |
CC1C(C2=C(C(=CC(=C2)OC)O)C(=O)O1)O
|
|
InChI |
InChI=1S/C11H12O5/c1-5-10(13)7-3-6(15-2)4-8(12)9(7)11(14)16-5/h3-5,10,12-13H,1-2H3
|
|
InChIKey |
MJPSOCVCUXUXLP-UHFFFAOYSA-N
|
|
Synonyms |
4,8-dihydroxy-6-methoxy-3-methyl-3,4-dihydro-1h-isochromen-1-one; 4,8-dihydroxy-6-methoxy-3-methyl-3,4-dihydroisochromen-1-one; CHEBI:181516; NCGC00380609-02!4,8-dihydroxy-6-methoxy-3-methyl-3,4-dihydroisochromen-1-one; 1362126-00-8
|
|
CAS | NA | |
PubChem CID | 45359158 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 224.21 | ALogp: | 1.3 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 76.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 16 | QED Weighted: | 0.705 |
Caco-2 Permeability: | -4.839 | MDCK Permeability: | 0.00000796 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.052 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.313 |
Blood-Brain-Barrier Penetration (BBB): | 0.771 | Plasma Protein Binding (PPB): | 74.35% |
Volume Distribution (VD): | 0.746 | Fu: | 18.60% |
CYP1A2-inhibitor: | 0.215 | CYP1A2-substrate: | 0.663 |
CYP2C19-inhibitor: | 0.067 | CYP2C19-substrate: | 0.832 |
CYP2C9-inhibitor: | 0.045 | CYP2C9-substrate: | 0.713 |
CYP2D6-inhibitor: | 0.025 | CYP2D6-substrate: | 0.55 |
CYP3A4-inhibitor: | 0.031 | CYP3A4-substrate: | 0.281 |
Clearance (CL): | 4.55 | Half-life (T1/2): | 0.806 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.088 |
Drug-inuced Liver Injury (DILI): | 0.45 | AMES Toxicity: | 0.652 |
Rat Oral Acute Toxicity: | 0.08 | Maximum Recommended Daily Dose: | 0.312 |
Skin Sensitization: | 0.136 | Carcinogencity: | 0.035 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.304 |
Respiratory Toxicity: | 0.847 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006047 | ![]() |
0.593 | D07MGA | ![]() |
0.300 | ||
ENC000757 | ![]() |
0.585 | D0L1JW | ![]() |
0.242 | ||
ENC004991 | ![]() |
0.574 | D0S5CH | ![]() |
0.239 | ||
ENC005556 | ![]() |
0.569 | D0I9HF | ![]() |
0.238 | ||
ENC006046 | ![]() |
0.561 | D0E9CD | ![]() |
0.237 | ||
ENC001992 | ![]() |
0.558 | D0AZ8C | ![]() |
0.237 | ||
ENC002022 | ![]() |
0.558 | D0DJ1B | ![]() |
0.233 | ||
ENC003003 | ![]() |
0.558 | D06GCK | ![]() |
0.231 | ||
ENC002629 | ![]() |
0.558 | D04UTT | ![]() |
0.222 | ||
ENC003296 | ![]() |
0.558 | D0D4HN | ![]() |
0.219 |