![]() |
Name |
1-Deoxyrubralactone
|
Molecular Formula | C14H12O5 | |
IUPAC Name* |
6-hydroxy-8-methoxy-1-methyl-1,2-dihydrocyclopenta[c]isochromene-3,5-dione
|
|
SMILES |
CC1CC(=O)C2=C1C3=C(C(=CC(=C3)OC)O)C(=O)O2
|
|
InChI |
InChI=1S/C14H12O5/c1-6-3-10(16)13-11(6)8-4-7(18-2)5-9(15)12(8)14(17)19-13/h4-6,15H,3H2,1-2H3
|
|
InChIKey |
WCUQVKQCPDVPRC-UHFFFAOYSA-N
|
|
Synonyms |
1-deoxyrubralactone; CHEMBL260980; BDBM50375301
|
|
CAS | NA | |
PubChem CID | 44451457 | |
ChEMBL ID | CHEMBL260980 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 260.24 | ALogp: | 1.9 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 72.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 19 | QED Weighted: | 0.853 |
Caco-2 Permeability: | -4.819 | MDCK Permeability: | 0.00002310 |
Pgp-inhibitor: | 0.045 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.019 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.596 |
Blood-Brain-Barrier Penetration (BBB): | 0.061 | Plasma Protein Binding (PPB): | 91.26% |
Volume Distribution (VD): | 0.983 | Fu: | 8.38% |
CYP1A2-inhibitor: | 0.981 | CYP1A2-substrate: | 0.918 |
CYP2C19-inhibitor: | 0.539 | CYP2C19-substrate: | 0.224 |
CYP2C9-inhibitor: | 0.762 | CYP2C9-substrate: | 0.926 |
CYP2D6-inhibitor: | 0.481 | CYP2D6-substrate: | 0.662 |
CYP3A4-inhibitor: | 0.552 | CYP3A4-substrate: | 0.121 |
Clearance (CL): | 1.933 | Half-life (T1/2): | 0.314 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.699 |
Drug-inuced Liver Injury (DILI): | 0.966 | AMES Toxicity: | 0.209 |
Rat Oral Acute Toxicity: | 0.655 | Maximum Recommended Daily Dose: | 0.879 |
Skin Sensitization: | 0.53 | Carcinogencity: | 0.176 |
Eye Corrosion: | 0.022 | Eye Irritation: | 0.851 |
Respiratory Toxicity: | 0.512 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002723 | ![]() |
0.677 | D07MGA | ![]() |
0.299 | ||
ENC002938 | ![]() |
0.631 | D0C1SF | ![]() |
0.272 | ||
ENC002959 | ![]() |
0.625 | D0G4KG | ![]() |
0.265 | ||
ENC003468 | ![]() |
0.527 | D06GCK | ![]() |
0.260 | ||
ENC003115 | ![]() |
0.520 | D0K8KX | ![]() |
0.244 | ||
ENC002502 | ![]() |
0.506 | D0FA2O | ![]() |
0.238 | ||
ENC003470 | ![]() |
0.506 | D04AIT | ![]() |
0.236 | ||
ENC004846 | ![]() |
0.486 | D0G5UB | ![]() |
0.231 | ||
ENC005191 | ![]() |
0.486 | D04UTT | ![]() |
0.226 | ||
ENC005808 | ![]() |
0.486 | D0J4IX | ![]() |
0.226 |