![]() |
Name |
Aspergillumarin A
|
Molecular Formula | C14H16O4 | |
IUPAC Name* |
(3R)-8-hydroxy-3-(4-oxopentyl)-3,4-dihydroisochromen-1-one
|
|
SMILES |
CC(=O)CCC[C@@H]1CC2=C(C(=CC=C2)O)C(=O)O1
|
|
InChI |
InChI=1S/C14H16O4/c1-9(15)4-2-6-11-8-10-5-3-7-12(16)13(10)14(17)18-11/h3,5,7,11,16H,2,4,6,8H2,1H3/t11-/m1/s1
|
|
InChIKey |
KEYNBOUNPFJEST-LLVKDONJSA-N
|
|
Synonyms |
Aspergillumarin A; CHEMBL2332662; ZINC31155701
|
|
CAS | NA | |
PubChem CID | 38346998 | |
ChEMBL ID | CHEMBL2332662 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 248.27 | ALogp: | 2.4 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 63.6 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.832 |
Caco-2 Permeability: | -4.583 | MDCK Permeability: | 0.00002290 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.01 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.437 | Plasma Protein Binding (PPB): | 92.03% |
Volume Distribution (VD): | 0.8 | Fu: | 4.48% |
CYP1A2-inhibitor: | 0.846 | CYP1A2-substrate: | 0.575 |
CYP2C19-inhibitor: | 0.681 | CYP2C19-substrate: | 0.122 |
CYP2C9-inhibitor: | 0.381 | CYP2C9-substrate: | 0.927 |
CYP2D6-inhibitor: | 0.744 | CYP2D6-substrate: | 0.736 |
CYP3A4-inhibitor: | 0.402 | CYP3A4-substrate: | 0.158 |
Clearance (CL): | 9.171 | Half-life (T1/2): | 0.838 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.468 |
Drug-inuced Liver Injury (DILI): | 0.548 | AMES Toxicity: | 0.152 |
Rat Oral Acute Toxicity: | 0.03 | Maximum Recommended Daily Dose: | 0.9 |
Skin Sensitization: | 0.739 | Carcinogencity: | 0.928 |
Eye Corrosion: | 0.06 | Eye Irritation: | 0.927 |
Respiratory Toxicity: | 0.101 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002573 | ![]() |
0.695 | D09OQV | ![]() |
0.267 | ||
ENC005780 | ![]() |
0.619 | D0H6QU | ![]() |
0.259 | ||
ENC005091 | ![]() |
0.593 | D0W9ZF | ![]() |
0.250 | ||
ENC003945 | ![]() |
0.569 | D07HBX | ![]() |
0.242 | ||
ENC004829 | ![]() |
0.569 | D05CKR | ![]() |
0.241 | ||
ENC002082 | ![]() |
0.564 | D01WUA | ![]() |
0.240 | ||
ENC000856 | ![]() |
0.564 | D0N1WU | ![]() |
0.239 | ||
ENC000584 | ![]() |
0.564 | D09QEI | ![]() |
0.238 | ||
ENC005781 | ![]() |
0.523 | D0E3OF | ![]() |
0.237 | ||
ENC004979 | ![]() |
0.515 | D0U0KW | ![]() |
0.235 |