![]() |
Name |
(1R,2R,5R,8R,9S,10R,11R,12R,13S)-12,13-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate
|
Molecular Formula | C19H23O6- | |
IUPAC Name* |
(1R,2R,5R,8R,9S,10R,11R,12R,13S)-12,13-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate
|
|
SMILES |
C[C@@]12[C@H]3[C@@H]([C@@]45C[C@@H](CC[C@H]4[C@@]3(C[C@@H]([C@@H]1O)O)OC2=O)C(=C)C5)C(=O)[O-]
|
|
InChI |
InChI=1S/C19H24O6/c1-8-5-18-6-9(8)3-4-11(18)19-7-10(20)14(21)17(2,16(24)25-19)13(19)12(18)15(22)23/h9-14,20-21H,1,3-7H2,2H3,(H,22,23)/p-1/t9-,10+,11-,12-,13-,14+,17-,18+,19-/m1/s1
|
|
InChIKey |
IGZIQAJJXGRAJF-OQAXFVLUSA-M
|
|
Synonyms |
GA34
|
|
CAS | NA | |
PubChem CID | 25245079 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 347.4 | ALogp: | 1.4 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 107.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 25 | QED Weighted: | 0.518 |
Caco-2 Permeability: | -5.618 | MDCK Permeability: | 0.00002880 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.821 |
Human Intestinal Absorption (HIA): | 0.046 | 20% Bioavailability (F20%): | 0.895 |
30% Bioavailability (F30%): | 0.209 |
Blood-Brain-Barrier Penetration (BBB): | 0.055 | Plasma Protein Binding (PPB): | 64.53% |
Volume Distribution (VD): | 0.254 | Fu: | 27.67% |
CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.128 |
CYP2C19-inhibitor: | 0.009 | CYP2C19-substrate: | 0.46 |
CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.377 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.135 |
CYP3A4-inhibitor: | 0.048 | CYP3A4-substrate: | 0.042 |
Clearance (CL): | 2.347 | Half-life (T1/2): | 0.83 |
hERG Blockers: | 0.084 | Human Hepatotoxicity (H-HT): | 0.921 |
Drug-inuced Liver Injury (DILI): | 0.869 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.706 | Maximum Recommended Daily Dose: | 0.709 |
Skin Sensitization: | 0.199 | Carcinogencity: | 0.05 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.019 |
Respiratory Toxicity: | 0.816 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000794 | ![]() |
0.654 | D04VIS | ![]() |
0.259 | ||
ENC002554 | ![]() |
0.634 | D04SFH | ![]() |
0.259 | ||
ENC002555 | ![]() |
0.630 | D0KR5B | ![]() |
0.252 | ||
ENC002542 | ![]() |
0.528 | D0D1SG | ![]() |
0.252 | ||
ENC002556 | ![]() |
0.478 | D0I1LH | ![]() |
0.250 | ||
ENC002559 | ![]() |
0.462 | D0CZ1Q | ![]() |
0.237 | ||
ENC002541 | ![]() |
0.426 | D08PIQ | ![]() |
0.237 | ||
ENC000143 | ![]() |
0.360 | D0V9DZ | ![]() |
0.237 | ||
ENC001975 | ![]() |
0.289 | D0Y2YP | ![]() |
0.236 | ||
ENC002009 | ![]() |
0.289 | D0Y7IU | ![]() |
0.232 |