![]() |
Name |
n'-Hydroxymethylnorcotinine
|
Molecular Formula | C10H12N2O2 | |
IUPAC Name* |
(5S)-1-(hydroxymethyl)-5-pyridin-3-ylpyrrolidin-2-one
|
|
SMILES |
C1CC(=O)N([C@@H]1C2=CN=CC=C2)CO
|
|
InChI |
InChI=1S/C10H12N2O2/c13-7-12-9(3-4-10(12)14)8-2-1-5-11-6-8/h1-2,5-6,9,13H,3-4,7H2/t9-/m0/s1
|
|
InChIKey |
GQUFOBHEPVFQMD-VIFPVBQESA-N
|
|
Synonyms |
n'-hydroxymethylnorcotinine; N'-hydroxymethyl-norcotinine; (5S)-1-(hydroxymethyl)-5-pyridin-3-ylpyrrolidin-2-one; 157129-55-0; (5S)-1-(hydroxymethyl)-5-(3-pyridinyl)-2-Pyrrolidinone; 1-(HYDROXYMETHYL)-5-PYRIDIN-3-YL-PYRROLIDIN-2-ONE; N-Hydroxymethylnorcotinine; N-(Hydroxymethyl)norcotinine; N-(hydroxymethyl)-norcotinine; CHEMBL3544621; CHEBI:173526; DTXSID801207736; (S)-1-(hydroxymethyl)-5-(3-pyridinyl)-2-Pyrrolidinone; (5S)-1-(hydroxymethyl)-5-(pyridin-3-yl)pyrrolidin-2-one
|
|
CAS | 157129-55-0 | |
PubChem CID | 25201488 | |
ChEMBL ID | CHEMBL3544621 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 192.21 | ALogp: | -0.4 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 53.4 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.763 |
Caco-2 Permeability: | -4.347 | MDCK Permeability: | 0.00001360 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.05 |
Human Intestinal Absorption (HIA): | 0.183 | 20% Bioavailability (F20%): | 0.1 |
30% Bioavailability (F30%): | 0.201 |
Blood-Brain-Barrier Penetration (BBB): | 0.267 | Plasma Protein Binding (PPB): | 13.74% |
Volume Distribution (VD): | 1.106 | Fu: | 80.22% |
CYP1A2-inhibitor: | 0.014 | CYP1A2-substrate: | 0.605 |
CYP2C19-inhibitor: | 0.033 | CYP2C19-substrate: | 0.703 |
CYP2C9-inhibitor: | 0.018 | CYP2C9-substrate: | 0.536 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.209 |
CYP3A4-inhibitor: | 0.064 | CYP3A4-substrate: | 0.387 |
Clearance (CL): | 5.206 | Half-life (T1/2): | 0.554 |
hERG Blockers: | 0.025 | Human Hepatotoxicity (H-HT): | 0.692 |
Drug-inuced Liver Injury (DILI): | 0.95 | AMES Toxicity: | 0.031 |
Rat Oral Acute Toxicity: | 0.027 | Maximum Recommended Daily Dose: | 0.941 |
Skin Sensitization: | 0.904 | Carcinogencity: | 0.407 |
Eye Corrosion: | 0.011 | Eye Irritation: | 0.692 |
Respiratory Toxicity: | 0.125 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001450 | ![]() |
0.674 | D0TY5N | ![]() |
0.674 | ||
ENC000048 | ![]() |
0.300 | D05QIM | ![]() |
0.471 | ||
ENC001516 | ![]() |
0.288 | D0T8LY | ![]() |
0.356 | ||
ENC002450 | ![]() |
0.276 | D06NVJ | ![]() |
0.327 | ||
ENC006142 | ![]() |
0.276 | D06BYV | ![]() |
0.254 | ||
ENC005321 | ![]() |
0.265 | D0PA5S | ![]() |
0.254 | ||
ENC004714 | ![]() |
0.250 | D03AJU | ![]() |
0.254 | ||
ENC003112 | ![]() |
0.250 | D0ZX1P | ![]() |
0.250 | ||
ENC005322 | ![]() |
0.246 | D0Z9QR | ![]() |
0.242 | ||
ENC002649 | ![]() |
0.246 | D0O2SR | ![]() |
0.242 |