![]() |
Name |
Halorosellinia A
|
Molecular Formula | C16H20O8 | |
IUPAC Name* |
(1S,2R,3S,4aS,9aR,10S)-1,2,3,5,8,10-hexahydroxy-6-methoxy-3-methyl-1,2,4,4a,9a,10-hexahydroanthracen-9-one
|
|
SMILES |
C[C@@]1(C[C@H]2[C@H]([C@@H]([C@H]1O)O)C(=O)C3=C([C@H]2O)C(=C(C=C3O)OC)O)O
|
|
InChI |
InChI=1S/C16H20O8/c1-16(23)4-5-8(14(21)15(16)22)13(20)9-6(17)3-7(24-2)12(19)10(9)11(5)18/h3,5,8,11,14-15,17-19,21-23H,4H2,1-2H3/t5-,8-,11-,14-,15+,16-/m0/s1
|
|
InChIKey |
BECCUNGYVJUQCO-CCAKZRNXSA-N
|
|
Synonyms |
Halorosellinia A
|
|
CAS | NA | |
PubChem CID | 24778338 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 340.32 | ALogp: | -0.9 |
HBD: | 6 | HBA: | 8 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 148.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 24 | QED Weighted: | 0.388 |
Caco-2 Permeability: | -5.983 | MDCK Permeability: | 0.00000336 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.984 |
Human Intestinal Absorption (HIA): | 0.841 | 20% Bioavailability (F20%): | 0.203 |
30% Bioavailability (F30%): | 0.985 |
Blood-Brain-Barrier Penetration (BBB): | 0.194 | Plasma Protein Binding (PPB): | 41.74% |
Volume Distribution (VD): | 1.394 | Fu: | 37.25% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.087 |
CYP2C19-inhibitor: | 0.007 | CYP2C19-substrate: | 0.442 |
CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.28 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.147 |
CYP3A4-inhibitor: | 0.004 | CYP3A4-substrate: | 0.096 |
Clearance (CL): | 1.841 | Half-life (T1/2): | 0.486 |
hERG Blockers: | 0.074 | Human Hepatotoxicity (H-HT): | 0.111 |
Drug-inuced Liver Injury (DILI): | 0.623 | AMES Toxicity: | 0.205 |
Rat Oral Acute Toxicity: | 0.052 | Maximum Recommended Daily Dose: | 0.008 |
Skin Sensitization: | 0.409 | Carcinogencity: | 0.021 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.102 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002522 | ![]() |
1.000 | D0C9XJ | ![]() |
0.280 | ||
ENC005224 | ![]() |
0.699 | D07VLY | ![]() |
0.280 | ||
ENC006090 | ![]() |
0.605 | D01XWG | ![]() |
0.277 | ||
ENC002510 | ![]() |
0.500 | D0S0LZ | ![]() |
0.267 | ||
ENC002597 | ![]() |
0.476 | D0R9WP | ![]() |
0.267 | ||
ENC002898 | ![]() |
0.452 | D0I9HF | ![]() |
0.266 | ||
ENC005502 | ![]() |
0.447 | D07MGA | ![]() |
0.265 | ||
ENC002598 | ![]() |
0.442 | D0J2NK | ![]() |
0.263 | ||
ENC002081 | ![]() |
0.435 | D0J4IX | ![]() |
0.263 | ||
ENC003445 | ![]() |
0.427 | D0AZ8C | ![]() |
0.258 |