![]() |
Name |
Dechlorogriseofulvin
|
Molecular Formula | C17H18O6 | |
IUPAC Name* |
(2S,5'R)-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione
|
|
SMILES |
C[C@@H]1CC(=O)C=C([C@]12C(=O)C3=C(O2)C=C(C=C3OC)OC)OC
|
|
InChI |
InChI=1S/C17H18O6/c1-9-5-10(18)6-14(22-4)17(9)16(19)15-12(21-3)7-11(20-2)8-13(15)23-17/h6-9H,5H2,1-4H3/t9-,17+/m1/s1
|
|
InChIKey |
QPCYNIYZPDJCMB-XLFHBGCDSA-N
|
|
Synonyms |
Dechlorogriseofulvin; 3680-32-8; 7-Dechloro Griseofulvin; 7-Dechlorogriseofulvin; ER776J3MGD; Spiro[benzofuran-2(3H),1'-[2]cyclohexene]-3,4'-dione, 2',4,6-trimethoxy-6'-methyl-; (2S,5'R)-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione; Spiro(benzofuran-2(3H),1'-(2)cyclohexene)-3,4'-dione, 2',4,6-trimethoxy-6'-methyl-; (1'S,6'R)-2',4,6-Trimethoxy-6'-methyl-3H-spiro[benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione; Dechlorogriseofulvin, 7-; UNII-ER776J3MGD; MEGxm0_000111; CHEMBL4086724; ACon1_000934; ZINC6030649; 2',4,6-Trimethoxy-6'-methylspiro(benzofuran-2(3H),1'-(2)cyclohexene)-3,4'-dione; NCGC00169215-01; NCGC00169215-02; GRISEOFULVIN IMPURITY B [EP IMPURITY]; BRD-K81081971-001-01-0; Q27896679; (2S,5'R)-3',4,6-trimethoxy-5'-methyl-spiro[benzofuran-2,4'-cyclohex-2-ene]-1',3-dione; (1'S,6'R)-2',4,6-TRIMETHOXY-6'-METHYLSPIRO(BENZOFURAN-2(3H),1'-(2)CYCLOHEXENE)-3,4'-DIONE; (2S)-2',4,6-Trimethoxy-6'beta-methylspiro[benzofuran-2(3H),1'-[2]cyclohexene]-3,4'-dione; NCGC00169215-02_C17H18O6_(2S,6'R)-2',4,6-Trimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione; SPIRO(BENZOFURAN-2(3H),1'-(2)CYCLOHEXENE)-3,4'-DIONE, 2',4,6-TRIMETHOXY-6'-METHYL-, (1'S,6'R)-
|
|
CAS | 3680-32-8 | |
PubChem CID | 24066885 | |
ChEMBL ID | CHEMBL4086724 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 318.32 | ALogp: | 1.6 |
HBD: | 0 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 71.1 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.853 |
Caco-2 Permeability: | -4.716 | MDCK Permeability: | 0.00004280 |
Pgp-inhibitor: | 0.657 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.008 |
30% Bioavailability (F30%): | 0.879 |
Blood-Brain-Barrier Penetration (BBB): | 0.459 | Plasma Protein Binding (PPB): | 72.25% |
Volume Distribution (VD): | 1.215 | Fu: | 19.56% |
CYP1A2-inhibitor: | 0.266 | CYP1A2-substrate: | 0.921 |
CYP2C19-inhibitor: | 0.198 | CYP2C19-substrate: | 0.887 |
CYP2C9-inhibitor: | 0.25 | CYP2C9-substrate: | 0.074 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.358 |
CYP3A4-inhibitor: | 0.167 | CYP3A4-substrate: | 0.842 |
Clearance (CL): | 11.199 | Half-life (T1/2): | 0.228 |
hERG Blockers: | 0.036 | Human Hepatotoxicity (H-HT): | 0.924 |
Drug-inuced Liver Injury (DILI): | 0.879 | AMES Toxicity: | 0.125 |
Rat Oral Acute Toxicity: | 0.844 | Maximum Recommended Daily Dose: | 0.612 |
Skin Sensitization: | 0.591 | Carcinogencity: | 0.868 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.032 |
Respiratory Toxicity: | 0.938 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002579 | ![]() |
1.000 | D0C1SF | ![]() |
0.684 | ||
ENC003538 | ![]() |
0.783 | D02LZB | ![]() |
0.302 | ||
ENC001073 | ![]() |
0.684 | D09DHY | ![]() |
0.300 | ||
ENC003227 | ![]() |
0.615 | D04TDQ | ![]() |
0.287 | ||
ENC002019 | ![]() |
0.566 | D06GCK | ![]() |
0.282 | ||
ENC005981 | ![]() |
0.472 | D01FFA | ![]() |
0.280 | ||
ENC002708 | ![]() |
0.465 | D0D4HN | ![]() |
0.276 | ||
ENC003637 | ![]() |
0.461 | D0AO5H | ![]() |
0.274 | ||
ENC001494 | ![]() |
0.438 | D0L1JW | ![]() |
0.265 | ||
ENC005584 | ![]() |
0.432 | D07MGA | ![]() |
0.265 |