![]() |
Name |
2-Chloro-5-methoxy-3-methylcyclohexa-2,5-diene-1,4-dione
|
Molecular Formula | C8H7ClO3 | |
IUPAC Name* |
2-chloro-5-methoxy-3-methylcyclohexa-2,5-diene-1,4-dione
|
|
SMILES |
CC1=C(C(=O)C=C(C1=O)OC)Cl
|
|
InChI |
InChI=1S/C8H7ClO3/c1-4-7(9)5(10)3-6(12-2)8(4)11/h3H,1-2H3
|
|
InChIKey |
SXCLPOXHBILXEY-UHFFFAOYSA-N
|
|
Synonyms |
2-chloro-5-methoxy-3-methylcyclohexa-2,5-diene-1,4-dione; CHEMBL253141
|
|
CAS | NA | |
PubChem CID | 23634447 | |
ChEMBL ID | CHEMBL253141 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 186.59 | ALogp: | 1.4 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 43.4 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.585 |
Caco-2 Permeability: | -4.32 | MDCK Permeability: | 0.00003510 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.007 |
Blood-Brain-Barrier Penetration (BBB): | 0.063 | Plasma Protein Binding (PPB): | 78.51% |
Volume Distribution (VD): | 1.14 | Fu: | 13.79% |
CYP1A2-inhibitor: | 0.98 | CYP1A2-substrate: | 0.937 |
CYP2C19-inhibitor: | 0.88 | CYP2C19-substrate: | 0.796 |
CYP2C9-inhibitor: | 0.483 | CYP2C9-substrate: | 0.359 |
CYP2D6-inhibitor: | 0.871 | CYP2D6-substrate: | 0.102 |
CYP3A4-inhibitor: | 0.142 | CYP3A4-substrate: | 0.231 |
Clearance (CL): | 6.22 | Half-life (T1/2): | 0.519 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.77 |
Drug-inuced Liver Injury (DILI): | 0.199 | AMES Toxicity: | 0.898 |
Rat Oral Acute Toxicity: | 0.945 | Maximum Recommended Daily Dose: | 0.852 |
Skin Sensitization: | 0.937 | Carcinogencity: | 0.893 |
Eye Corrosion: | 0.928 | Eye Irritation: | 0.98 |
Respiratory Toxicity: | 0.972 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002293 | ![]() |
0.676 | D03GET | ![]() |
0.288 | ||
ENC002785 | ![]() |
0.522 | D0C1SF | ![]() |
0.231 | ||
ENC005529 | ![]() |
0.377 | D0MM8N | ![]() |
0.213 | ||
ENC003030 | ![]() |
0.371 | D0K7LU | ![]() |
0.212 | ||
ENC002282 | ![]() |
0.371 | D0B9EJ | ![]() |
0.207 | ||
ENC002318 | ![]() |
0.367 | D0Y0GH | ![]() |
0.200 | ||
ENC005330 | ![]() |
0.367 | D0G4KG | ![]() |
0.200 | ||
ENC005150 | ![]() |
0.367 | D0F8RA | ![]() |
0.200 | ||
ENC005342 | ![]() |
0.365 | D0I0DS | ![]() |
0.200 | ||
ENC005166 | ![]() |
0.365 | D09WKB | ![]() |
0.197 |