![]() |
Name |
Cyclonerotriol
|
Molecular Formula | C15H28O3 | |
IUPAC Name* |
(E,6R)-6-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-2-methylhept-2-ene-1,6-diol
|
|
SMILES |
C[C@H]1[C@@H](CC[C@@]1(C)O)[C@@](C)(CC/C=C(\C)/CO)O
|
|
InChI |
InChI=1S/C15H28O3/c1-11(10-16)6-5-8-15(4,18)13-7-9-14(3,17)12(13)2/h6,12-13,16-18H,5,7-10H2,1-4H3/b11-6+/t12-,13+,14+,15+/m0/s1
|
|
InChIKey |
QGUPPGVBDCWDSK-BSYVWGKESA-N
|
|
Synonyms |
Cyclonerotriol; Cyclonerotriol-; 57689-00-6; 37C72E679V; (2E,6R)-6-((1R,2S,3R)-3-Hydroxy-2,3-dimethylcyclopentyl)-2-methyl-2-heptene-1,6-diol; (E,6R)-6-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-2-methylhept-2-ene-1,6-diol; 2-Heptene-1,6-diol, 6-((1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl)-2-methyl-, (2E,6R)-; UNII-37C72E679V; Q27896946; 2-HEPTENE-1,6-DIOL, 6-(3-HYDROXY-2,3-DIMETHYLCYCLOPENTYL)-2-METHYL-, (1R-(1.ALPHA.(2E,6R*),2.BETA.,3.BETA.))-; 2-Heptene-1,6-diol, 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methyl-, (1R-(1alpha(2E,6R*),2beta,3beta))-
|
|
CAS | 57689-00-6 | |
PubChem CID | 21596370 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 256.38 | ALogp: | 2.0 |
HBD: | 3 | HBA: | 3 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 60.7 | Aromatic Rings: | 1 |
Heavy Atoms: | 18 | QED Weighted: | 0.663 |
Caco-2 Permeability: | -4.282 | MDCK Permeability: | 0.00002130 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.027 |
Human Intestinal Absorption (HIA): | 0.34 | 20% Bioavailability (F20%): | 0.064 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.955 | Plasma Protein Binding (PPB): | 71.42% |
Volume Distribution (VD): | 1.016 | Fu: | 30.69% |
CYP1A2-inhibitor: | 0.034 | CYP1A2-substrate: | 0.308 |
CYP2C19-inhibitor: | 0.033 | CYP2C19-substrate: | 0.791 |
CYP2C9-inhibitor: | 0.019 | CYP2C9-substrate: | 0.216 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.119 |
CYP3A4-inhibitor: | 0.042 | CYP3A4-substrate: | 0.233 |
Clearance (CL): | 5.378 | Half-life (T1/2): | 0.807 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.036 |
Drug-inuced Liver Injury (DILI): | 0.068 | AMES Toxicity: | 0.003 |
Rat Oral Acute Toxicity: | 0.01 | Maximum Recommended Daily Dose: | 0.022 |
Skin Sensitization: | 0.778 | Carcinogencity: | 0.028 |
Eye Corrosion: | 0.91 | Eye Irritation: | 0.959 |
Respiratory Toxicity: | 0.019 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000952 | ![]() |
0.750 | D07QKN | ![]() |
0.254 | ||
ENC004079 | ![]() |
0.576 | D0W6DG | ![]() |
0.221 | ||
ENC004078 | ![]() |
0.532 | D0T2PL | ![]() |
0.217 | ||
ENC003948 | ![]() |
0.532 | D02VPX | ![]() |
0.210 | ||
ENC004067 | ![]() |
0.500 | D05BTM | ![]() |
0.206 | ||
ENC005830 | ![]() |
0.400 | D05XQE | ![]() |
0.202 | ||
ENC005926 | ![]() |
0.368 | D08PIQ | ![]() |
0.200 | ||
ENC003627 | ![]() |
0.350 | D02ZGI | ![]() |
0.194 | ||
ENC001455 | ![]() |
0.343 | D03VFL | ![]() |
0.190 | ||
ENC004728 | ![]() |
0.338 | D0X7XG | ![]() |
0.187 |