![]() |
Name |
Pinoresinol
|
Molecular Formula | C20H22O6 | |
IUPAC Name* |
4-[(3aR,6S,6aR)-6-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol
|
|
SMILES |
COC1=C(C=CC(=C1)[C@@H]2[C@H]3COC([C@H]3CO2)C4=CC(=C(C=C4)O)OC)O
|
|
InChI |
InChI=1S/C20H22O6/c1-23-17-7-11(3-5-15(17)21)19-13-9-26-20(14(13)10-25-19)12-4-6-16(22)18(8-12)24-2/h3-8,13-14,19-22H,9-10H2,1-2H3/t13-,14-,19+,20?/m0/s1
|
|
InChIKey |
HGXBRUKMWQGOIE-USWSZDBUSA-N
|
|
Synonyms |
Pinoresinol; SCHEMBL15394782; AKOS032948366; 4-[(3aR,6S,6aR)-6-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenol
|
|
CAS | NA | |
PubChem CID | 17750970 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 358.4 | ALogp: | 2.3 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 77.4 | Aromatic Rings: | 4 |
Heavy Atoms: | 26 | QED Weighted: | 0.861 |
Caco-2 Permeability: | -4.778 | MDCK Permeability: | 0.00001680 |
Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.687 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.011 |
30% Bioavailability (F30%): | 0.093 |
Blood-Brain-Barrier Penetration (BBB): | 0.104 | Plasma Protein Binding (PPB): | 94.10% |
Volume Distribution (VD): | 0.561 | Fu: | 8.47% |
CYP1A2-inhibitor: | 0.052 | CYP1A2-substrate: | 0.803 |
CYP2C19-inhibitor: | 0.075 | CYP2C19-substrate: | 0.684 |
CYP2C9-inhibitor: | 0.363 | CYP2C9-substrate: | 0.687 |
CYP2D6-inhibitor: | 0.333 | CYP2D6-substrate: | 0.887 |
CYP3A4-inhibitor: | 0.307 | CYP3A4-substrate: | 0.617 |
Clearance (CL): | 9.388 | Half-life (T1/2): | 0.594 |
hERG Blockers: | 0.236 | Human Hepatotoxicity (H-HT): | 0.203 |
Drug-inuced Liver Injury (DILI): | 0.725 | AMES Toxicity: | 0.162 |
Rat Oral Acute Toxicity: | 0.135 | Maximum Recommended Daily Dose: | 0.831 |
Skin Sensitization: | 0.929 | Carcinogencity: | 0.246 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.899 |
Respiratory Toxicity: | 0.897 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001416 | ![]() |
0.382 | D0AZ8C | ![]() |
0.387 | ||
ENC004820 | ![]() |
0.378 | D0D4HN | ![]() |
0.314 | ||
ENC001961 | ![]() |
0.378 | D07MGA | ![]() |
0.311 | ||
ENC001848 | ![]() |
0.333 | D06GCK | ![]() |
0.300 | ||
ENC001751 | ![]() |
0.333 | D0Q9ON | ![]() |
0.287 | ||
ENC001085 | ![]() |
0.327 | D01DBQ | ![]() |
0.280 | ||
ENC001962 | ![]() |
0.321 | D0F7CS | ![]() |
0.279 | ||
ENC005040 | ![]() |
0.321 | D09NIB | ![]() |
0.278 | ||
ENC002759 | ![]() |
0.321 | D0U3YB | ![]() |
0.264 | ||
ENC005411 | ![]() |
0.315 | D05HSC | ![]() |
0.263 |