![]() |
Name |
Nigerasperone B
|
Molecular Formula | C32H30O12 | |
IUPAC Name* |
9-(2,5-dihydroxy-8,10-dimethoxy-2-methyl-4-oxo-3H-benzo[h]chromen-6-yl)-2,5-dihydroxy-8,10-dimethoxy-2-methyl-3H-benzo[h]chromen-4-one
|
|
SMILES |
CC1(CC(=O)C2=C(C=C3C=C(C(=C(C3=C2O1)OC)C4=C(C5=C(C6=C4C=C(C=C6OC)OC)OC(CC5=O)(C)O)O)OC)O)O
|
|
InChI |
InChI=1S/C32H30O12/c1-31(37)11-17(34)24-16(33)7-13-8-19(40-4)26(28(42-6)21(13)29(24)43-31)23-15-9-14(39-3)10-20(41-5)22(15)30-25(27(23)36)18(35)12-32(2,38)44-30/h7-10,33,36-38H,11-12H2,1-6H3
|
|
InChIKey |
VYRJMNNIHZJSTP-UHFFFAOYSA-N
|
|
Synonyms |
Nigerasperone B; 9-(2,5-Dihydroxy-8,10-dimethoxy-2-methyl-4-oxo-3H-benzo[h]chromen-6-yl)-2,5-dihydroxy-8,10-dimethoxy-2-methyl-3H-benzo[h]chromen-4-one
|
|
CAS | NA | |
PubChem CID | 16127423 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 606.6 | ALogp: | 4.6 |
HBD: | 4 | HBA: | 12 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 170.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 44 | QED Weighted: | 0.241 |
Caco-2 Permeability: | -5.311 | MDCK Permeability: | 0.00001950 |
Pgp-inhibitor: | 0.979 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.516 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.004 | Plasma Protein Binding (PPB): | 71.00% |
Volume Distribution (VD): | 0.832 | Fu: | 29.83% |
CYP1A2-inhibitor: | 0.184 | CYP1A2-substrate: | 0.973 |
CYP2C19-inhibitor: | 0.041 | CYP2C19-substrate: | 0.517 |
CYP2C9-inhibitor: | 0.261 | CYP2C9-substrate: | 0.795 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.247 |
CYP3A4-inhibitor: | 0.231 | CYP3A4-substrate: | 0.296 |
Clearance (CL): | 7.552 | Half-life (T1/2): | 0.094 |
hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.124 |
Drug-inuced Liver Injury (DILI): | 0.969 | AMES Toxicity: | 0.098 |
Rat Oral Acute Toxicity: | 0.074 | Maximum Recommended Daily Dose: | 0.26 |
Skin Sensitization: | 0.05 | Carcinogencity: | 0.01 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.022 |
Respiratory Toxicity: | 0.073 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000970 | ![]() |
0.818 | D06GCK | ![]() |
0.313 | ||
ENC000969 | ![]() |
0.756 | D02LZB | ![]() |
0.283 | ||
ENC003048 | ![]() |
0.688 | D09DHY | ![]() |
0.282 | ||
ENC003149 | ![]() |
0.664 | D0C1SF | ![]() |
0.267 | ||
ENC000984 | ![]() |
0.630 | D0V8HJ | ![]() |
0.264 | ||
ENC005173 | ![]() |
0.621 | D03RTK | ![]() |
0.260 | ||
ENC005171 | ![]() |
0.610 | D0D4HN | ![]() |
0.258 | ||
ENC003508 | ![]() |
0.599 | D0V6OA | ![]() |
0.252 | ||
ENC005776 | ![]() |
0.599 | D0NJ3V | ![]() |
0.248 | ||
ENC002884 | ![]() |
0.588 | D0Y6CE | ![]() |
0.246 |