|
Name |
(-)-4,6'-Anhydrooxysporidinone
|
Molecular Formula | C28H41NO5 | |
IUPAC Name* |
(5aR,9aS)-4-[(2S,5R,6R)-6-[(E)-4,6-dimethyloct-2-en-2-yl]-5-methyloxan-2-yl]-9a-hydroxy-2-methyl-5a,6,8,9-tetrahydro-[1]benzofuro[3,2-c]pyridine-3,7-dione
|
|
SMILES |
CCC(C)CC(C)/C=C(\C)/[C@H]1[C@@H](CC[C@H](O1)C2=C3C(=CN(C2=O)C)[C@]4(CCC(=O)C[C@H]4O3)O)C
|
|
InChI |
InChI=1S/C28H41NO5/c1-7-16(2)12-17(3)13-19(5)25-18(4)8-9-22(33-25)24-26-21(15-29(6)27(24)31)28(32)11-10-20(30)14-23(28)34-26/h13,15-18,22-23,25,32H,7-12,14H2,1-6H3/b19-13+/t16?,17?,18-,22+,23-,25-,28+/m1/s1
|
|
InChIKey |
HIEAPHJQEBHMLL-YKXVSDKYSA-N
|
|
Synonyms |
(-)-4,6'-anhydrooxysporidinone
|
|
CAS | NA | |
PubChem CID | 16109804 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 471.6 | ALogp: | 3.4 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 76.1 | Aromatic Rings: | 4 |
Heavy Atoms: | 34 | QED Weighted: | 0.568 |
Caco-2 Permeability: | -4.718 | MDCK Permeability: | 0.00001430 |
Pgp-inhibitor: | 0.982 | Pgp-substrate: | 0.589 |
Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.014 |
30% Bioavailability (F30%): | 0.964 |
Blood-Brain-Barrier Penetration (BBB): | 0.705 | Plasma Protein Binding (PPB): | 90.46% |
Volume Distribution (VD): | 1.991 | Fu: | 2.95% |
CYP1A2-inhibitor: | 0.033 | CYP1A2-substrate: | 0.841 |
CYP2C19-inhibitor: | 0.392 | CYP2C19-substrate: | 0.95 |
CYP2C9-inhibitor: | 0.494 | CYP2C9-substrate: | 0.763 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.371 |
CYP3A4-inhibitor: | 0.701 | CYP3A4-substrate: | 0.883 |
Clearance (CL): | 8.127 | Half-life (T1/2): | 0.096 |
hERG Blockers: | 0.109 | Human Hepatotoxicity (H-HT): | 0.946 |
Drug-inuced Liver Injury (DILI): | 0.334 | AMES Toxicity: | 0.064 |
Rat Oral Acute Toxicity: | 0.949 | Maximum Recommended Daily Dose: | 0.952 |
Skin Sensitization: | 0.138 | Carcinogencity: | 0.069 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.905 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002822 | 0.781 | D0W2EK | 0.247 | ||||
ENC004957 | 0.547 | D02IQY | 0.225 | ||||
ENC003476 | 0.538 | D04JHN | 0.224 | ||||
ENC003004 | 0.538 | D0I2SD | 0.220 | ||||
ENC005829 | 0.508 | D0L7AS | 0.219 | ||||
ENC004958 | 0.376 | D0X5KF | 0.219 | ||||
ENC002816 | 0.314 | D06YFA | 0.218 | ||||
ENC004573 | 0.310 | D05AFC | 0.217 | ||||
ENC003638 | 0.296 | D03SKD | 0.215 | ||||
ENC003489 | 0.289 | D0PG8O | 0.215 |