![]() |
Name |
12alpha-Fumitremorgin C
|
Molecular Formula | C22H25N3O3 | |
IUPAC Name* |
7-methoxy-12-(2-methylprop-1-enyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione
|
|
SMILES |
CC(=CC1C2=C(CC3N1C(=O)C4CCCN4C3=O)C5=C(N2)C=C(C=C5)OC)C
|
|
InChI |
InChI=1S/C22H25N3O3/c1-12(2)9-18-20-15(14-7-6-13(28-3)10-16(14)23-20)11-19-21(26)24-8-4-5-17(24)22(27)25(18)19/h6-7,9-10,17-19,23H,4-5,8,11H2,1-3H3
|
|
InChIKey |
DBEYVIGIPJSTOR-UHFFFAOYSA-N
|
|
Synonyms |
12alpha-Fumitremorgin C; MEGxm0_000008; CHEBI:182237; BCP28921; NCGC00380742-01; (1S,12S,15S)-7-methoxy-12-(2-methylprop-1-enyl)-10,13,19-triazapentacyclo[11.7.0.0^{3,11.0^{4,9.0^{15,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione; 7-methoxy-12-(2-methylprop-1-enyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione; NCGC00380742-01_C22H25N3O3_9-Methoxy-12-(2-methyl-1-propen-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione
|
|
CAS | NA | |
PubChem CID | 14105029 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 379.5 | ALogp: | 3.0 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 65.6 | Aromatic Rings: | 5 |
Heavy Atoms: | 28 | QED Weighted: | 0.809 |
Caco-2 Permeability: | -4.757 | MDCK Permeability: | 0.00000849 |
Pgp-inhibitor: | 0.263 | Pgp-substrate: | 0.437 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.027 |
30% Bioavailability (F30%): | 0.977 |
Blood-Brain-Barrier Penetration (BBB): | 0.498 | Plasma Protein Binding (PPB): | 93.44% |
Volume Distribution (VD): | 0.807 | Fu: | 4.92% |
CYP1A2-inhibitor: | 0.052 | CYP1A2-substrate: | 0.539 |
CYP2C19-inhibitor: | 0.867 | CYP2C19-substrate: | 0.727 |
CYP2C9-inhibitor: | 0.761 | CYP2C9-substrate: | 0.891 |
CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.226 |
CYP3A4-inhibitor: | 0.782 | CYP3A4-substrate: | 0.845 |
Clearance (CL): | 7.385 | Half-life (T1/2): | 0.167 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.965 |
Drug-inuced Liver Injury (DILI): | 0.956 | AMES Toxicity: | 0.057 |
Rat Oral Acute Toxicity: | 0.83 | Maximum Recommended Daily Dose: | 0.861 |
Skin Sensitization: | 0.203 | Carcinogencity: | 0.084 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.943 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001060 | ![]() |
1.000 | D05MQK | ![]() |
0.325 | ||
ENC003264 | ![]() |
0.636 | D0J4JM | ![]() |
0.301 | ||
ENC001958 | ![]() |
0.636 | D0G8NJ | ![]() |
0.298 | ||
ENC003265 | ![]() |
0.618 | D0U7GP | ![]() |
0.283 | ||
ENC002020 | ![]() |
0.584 | D01JGV | ![]() |
0.283 | ||
ENC001941 | ![]() |
0.534 | D06YFA | ![]() |
0.277 | ||
ENC002519 | ![]() |
0.524 | D0H4JM | ![]() |
0.273 | ||
ENC004458 | ![]() |
0.520 | D09OBB | ![]() |
0.269 | ||
ENC003013 | ![]() |
0.491 | D0P0RX | ![]() |
0.264 | ||
ENC002520 | ![]() |
0.481 | D00XHD | ![]() |
0.258 |