![]() |
Name |
Bufotalin
|
Molecular Formula | C26H36O6 | |
IUPAC Name* |
[(3S,5R,8R,9S,10S,13R,14S,16S,17R)-3,14-dihydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate
|
|
SMILES |
CC(=O)O[C@H]1C[C@@]2([C@@H]3CC[C@@H]4C[C@H](CC[C@@]4([C@H]3CC[C@@]2([C@H]1C5=COC(=O)C=C5)C)C)O)O
|
|
InChI |
InChI=1S/C26H36O6/c1-15(27)32-21-13-26(30)20-6-5-17-12-18(28)8-10-24(17,2)19(20)9-11-25(26,3)23(21)16-4-7-22(29)31-14-16/h4,7,14,17-21,23,28,30H,5-6,8-13H2,1-3H3/t17-,18+,19+,20-,21+,23+,24+,25-,26+/m1/s1
|
|
InChIKey |
VOZHMAYHYHEWBW-NVOOAVKYSA-N
|
|
Synonyms |
Bufotalin; Bufotaline; 471-95-4; EGL9670I6P; CHEBI:80799; Bufa-20,22-dienolide, 16-(acetyloxy)-3,14-dihydroxy-, (3beta,5beta,16beta)-; [(3S,5R,8R,9S,10S,13R,14S,16S,17R)-3,14-dihydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate; UNII-EGL9670I6P; Closantelsodium; NSC-89596; NSC 89596; BUFOTALIN [MI]; SCHEMBL865713; CHEMBL463064; DTXSID60894008; (3S,5R,8R,9S,10S,13R,14S,16S,17R)-3,14-dihydroxy-10,13-dimethyl-17-(2-oxo-2H-pyran-5-yl)hexadecahydro-1H-cyclopenta[a]phenanthren-16-yl acetate; HY-N0878; MFCD00210248; ZINC27631123; AKOS030526151; CS-3695; NCGC00485932-01; AC-34086; AS-77232; C16923; 471B954; Q-100499; Q5760807; 3beta-14,16beta-Trihydroxy-5beta-bufa-20,22-dienolide; 3beta,14,16beta-Trihydroxy-5beta-bufa-20,22-dienolide 16-acetate; 5beta-Bufa-20,22-dienolide, 3beta,14,16beta-trihydroxy-, 16-acetate; 3.BETA.,14,16.BETA.-TRIHYDROXY-5.BETA.-BUFA-20,22-DIENOLIDE 16-ACETATE; 5-beta-BUFA-20,22-DIENOLIDE, 3-beta,14,16-beta-TRIHYDROXY-, 16-ACETATE
|
|
CAS | 471-95-4 | |
PubChem CID | 12302120 | |
ChEMBL ID | CHEMBL463064 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 444.6 | ALogp: | 2.5 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 93.1 | Aromatic Rings: | 5 |
Heavy Atoms: | 32 | QED Weighted: | 0.654 |
Caco-2 Permeability: | -4.852 | MDCK Permeability: | 0.00005780 |
Pgp-inhibitor: | 0.174 | Pgp-substrate: | 0.999 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.526 |
30% Bioavailability (F30%): | 0.967 |
Blood-Brain-Barrier Penetration (BBB): | 0.287 | Plasma Protein Binding (PPB): | 87.96% |
Volume Distribution (VD): | 0.782 | Fu: | 9.51% |
CYP1A2-inhibitor: | 0.029 | CYP1A2-substrate: | 0.234 |
CYP2C19-inhibitor: | 0.066 | CYP2C19-substrate: | 0.538 |
CYP2C9-inhibitor: | 0.141 | CYP2C9-substrate: | 0.061 |
CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.171 |
CYP3A4-inhibitor: | 0.729 | CYP3A4-substrate: | 0.446 |
Clearance (CL): | 9.234 | Half-life (T1/2): | 0.316 |
hERG Blockers: | 0.597 | Human Hepatotoxicity (H-HT): | 0.371 |
Drug-inuced Liver Injury (DILI): | 0.7 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.868 | Maximum Recommended Daily Dose: | 0.916 |
Skin Sensitization: | 0.855 | Carcinogencity: | 0.655 |
Eye Corrosion: | 0.024 | Eye Irritation: | 0.036 |
Respiratory Toxicity: | 0.969 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005144 | ![]() |
0.575 | D00VZZ | ![]() |
0.457 | ||
ENC005141 | ![]() |
0.465 | D0G3SH | ![]() |
0.383 | ||
ENC005147 | ![]() |
0.457 | D03ZTE | ![]() |
0.383 | ||
ENC005145 | ![]() |
0.444 | D0B4RU | ![]() |
0.378 | ||
ENC005140 | ![]() |
0.385 | D09NNA | ![]() |
0.364 | ||
ENC005146 | ![]() |
0.385 | D0U3GL | ![]() |
0.364 | ||
ENC001009 | ![]() |
0.383 | D0Q6NZ | ![]() |
0.360 | ||
ENC000609 | ![]() |
0.383 | D04DJN | ![]() |
0.358 | ||
ENC005068 | ![]() |
0.344 | D07BSQ | ![]() |
0.354 | ||
ENC002305 | ![]() |
0.342 | D04RYU | ![]() |
0.351 |