|
Name |
Monascorubrin
|
Molecular Formula | C23H26O5 | |
IUPAC Name* |
(9aR)-9a-methyl-3-octanoyl-6-[(E)-prop-1-enyl]furo[3,2-g]isochromene-2,9-dione
|
|
SMILES |
CCCCCCCC(=O)C1=C2C=C3C=C(OC=C3C(=O)[C@@]2(OC1=O)C)/C=C/C
|
|
InChI |
InChI=1S/C23H26O5/c1-4-6-7-8-9-11-19(24)20-18-13-15-12-16(10-5-2)27-14-17(15)21(25)23(18,3)28-22(20)26/h5,10,12-14H,4,6-9,11H2,1-3H3/b10-5+/t23-/m1/s1
|
|
InChIKey |
IIPVSGPTPPURBD-HAOIVFDCSA-N
|
|
Synonyms |
Monascorubrin; Monasred; 13283-90-4; PRW98QJ428; (9aR)-9a-methyl-3-octanoyl-6-[(E)-prop-1-enyl]furo[3,2-g]isochromene-2,9-dione; CCRIS 7225; UNII-PRW98QJ428; CHEMBL1215464; CHEBI:156408; DTXSID101037235; HY-N8492; ZINC58568858; 2H-Furo(3,2-g)(2)benzopyran-2,9(9aH)-dione, 9a-methyl-3-(1-oxooctyl)-6-(1-propenyl)-, (R-(E))-; CS-0144836; Q27286726; (9AR)-9A-METHYL-3-(1-OXOOCTYL)-6-(1E)-1-PROPEN-1-YL-2H-FURO(3,2-G)(2)BENZOPYRAN-2,9(9AH)-DIONE; (9aR)-9a-methyl-3-octanoyl-6-[(1E)-prop-1-en-1-yl]-2H-furo[3,2-g][2]benzopyran-2,9(9aH)-dione; (9aR)-9a-methyl-3-octanoyl-6-[(1E)-prop-1-en-1-yl]-2H-furo[3,2-g]isochromene-2,9(9aH)-dione; 2H-FURO(3,2-G)(2)BENZOPYRAN-2,9(9AH)-DIONE, 9A-METHYL-3-(1-OXOOCTYL)-6-(1E)-1-PROPEN-1-YL-, (9AR)-
|
|
CAS | 13283-90-4 | |
PubChem CID | 12118084 | |
ChEMBL ID | CHEMBL1215464 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 382.4 | ALogp: | 4.3 |
HBD: | 0 | HBA: | 5 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 69.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 28 | QED Weighted: | 0.338 |
Caco-2 Permeability: | -4.996 | MDCK Permeability: | 0.00002350 |
Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.016 |
Human Intestinal Absorption (HIA): | 0.333 | 20% Bioavailability (F20%): | 1 |
30% Bioavailability (F30%): | 0.979 |
Blood-Brain-Barrier Penetration (BBB): | 0.011 | Plasma Protein Binding (PPB): | 91.20% |
Volume Distribution (VD): | 2.026 | Fu: | 6.54% |
CYP1A2-inhibitor: | 0.803 | CYP1A2-substrate: | 0.708 |
CYP2C19-inhibitor: | 0.878 | CYP2C19-substrate: | 0.374 |
CYP2C9-inhibitor: | 0.875 | CYP2C9-substrate: | 0.095 |
CYP2D6-inhibitor: | 0.582 | CYP2D6-substrate: | 0.035 |
CYP3A4-inhibitor: | 0.926 | CYP3A4-substrate: | 0.302 |
Clearance (CL): | 1.51 | Half-life (T1/2): | 0.601 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.968 |
Drug-inuced Liver Injury (DILI): | 0.964 | AMES Toxicity: | 0.971 |
Rat Oral Acute Toxicity: | 0.983 | Maximum Recommended Daily Dose: | 0.916 |
Skin Sensitization: | 0.963 | Carcinogencity: | 0.91 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.094 |
Respiratory Toxicity: | 0.806 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001880 | 0.923 | D03ZJE | 0.245 | ||||
ENC002331 | 0.458 | D0UU9Y | 0.243 | ||||
ENC004245 | 0.429 | D0L7AS | 0.236 | ||||
ENC002208 | 0.402 | D02AXG | 0.229 | ||||
ENC005364 | 0.400 | D09ANG | 0.226 | ||||
ENC002525 | 0.393 | D0I4DQ | 0.225 | ||||
ENC002010 | 0.381 | D0OR6A | 0.223 | ||||
ENC001874 | 0.374 | D0G2KD | 0.217 | ||||
ENC004374 | 0.362 | D06CVT | 0.214 | ||||
ENC003626 | 0.323 | D0P1FO | 0.214 |