![]() |
Name |
(R)-(-)-14-Methyl-8-hexadecyn-1-ol
|
Molecular Formula | C17H32O | |
IUPAC Name* |
(14R)-14-methylhexadec-8-yn-1-ol
|
|
SMILES |
CC[C@@H](C)CCCCC#CCCCCCCCO
|
|
InChI |
InChI=1S/C17H32O/c1-3-17(2)15-13-11-9-7-5-4-6-8-10-12-14-16-18/h17-18H,3-4,6,8-16H2,1-2H3/t17-/m1/s1
|
|
InChIKey |
GGNPJEDYBWMUJF-QGZVFWFLSA-N
|
|
Synonyms |
(R)-(-)-14-Methyl-8-hexadecyn-1-ol; 64566-18-3; 14-Methyl-8-hexadecyn-1-ol #; DTXSID601016004; [R,(?)]-14-Methyl-8-hexadecyne-1-ol
|
|
CAS | 64566-18-3 | |
PubChem CID | 10944926 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 252.4 | ALogp: | 6.4 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 11 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 20.2 | Aromatic Rings: | 0 |
Heavy Atoms: | 18 | QED Weighted: | 0.391 |
Caco-2 Permeability: | -4.587 | MDCK Permeability: | 0.00001120 |
Pgp-inhibitor: | 0.248 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.984 |
30% Bioavailability (F30%): | 0.988 |
Blood-Brain-Barrier Penetration (BBB): | 0.35 | Plasma Protein Binding (PPB): | 97.30% |
Volume Distribution (VD): | 1.336 | Fu: | 0.94% |
CYP1A2-inhibitor: | 0.882 | CYP1A2-substrate: | 0.208 |
CYP2C19-inhibitor: | 0.783 | CYP2C19-substrate: | 0.065 |
CYP2C9-inhibitor: | 0.506 | CYP2C9-substrate: | 0.936 |
CYP2D6-inhibitor: | 0.253 | CYP2D6-substrate: | 0.046 |
CYP3A4-inhibitor: | 0.439 | CYP3A4-substrate: | 0.078 |
Clearance (CL): | 7.697 | Half-life (T1/2): | 0.268 |
hERG Blockers: | 0.054 | Human Hepatotoxicity (H-HT): | 0.026 |
Drug-inuced Liver Injury (DILI): | 0.042 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.016 | Maximum Recommended Daily Dose: | 0.251 |
Skin Sensitization: | 0.957 | Carcinogencity: | 0.06 |
Eye Corrosion: | 0.988 | Eye Irritation: | 0.942 |
Respiratory Toxicity: | 0.24 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001596 | ![]() |
0.698 | D0Y8DP | ![]() |
0.333 | ||
ENC000850 | ![]() |
0.552 | D0P1RL | ![]() |
0.326 | ||
ENC000551 | ![]() |
0.531 | D00AOJ | ![]() |
0.326 | ||
ENC000803 | ![]() |
0.523 | D07ILQ | ![]() |
0.321 | ||
ENC001260 | ![]() |
0.500 | D05ATI | ![]() |
0.307 | ||
ENC000809 | ![]() |
0.500 | D0O1PH | ![]() |
0.300 | ||
ENC000549 | ![]() |
0.485 | D0MM8N | ![]() |
0.300 | ||
ENC000587 | ![]() |
0.480 | D0Z5SM | ![]() |
0.296 | ||
ENC000515 | ![]() |
0.478 | D05QNO | ![]() |
0.286 | ||
ENC000517 | ![]() |
0.477 | D0G2KD | ![]() |
0.284 |