![]() |
Name |
Asparasone A
|
Molecular Formula | C18H14O8 | |
IUPAC Name* |
1,3,6,8-tetrahydroxy-2-(1-hydroxy-3-oxobutyl)anthracene-9,10-dione
|
|
SMILES |
CC(=O)CC(C1=C(C=C2C(=C1O)C(=O)C3=C(C2=O)C=C(C=C3O)O)O)O
|
|
InChI |
InChI=1S/C18H14O8/c1-6(19)2-10(21)15-12(23)5-9-14(18(15)26)17(25)13-8(16(9)24)3-7(20)4-11(13)22/h3-5,10,20-23,26H,2H2,1H3
|
|
InChIKey |
JXNCVINFWDAYCA-UHFFFAOYSA-N
|
|
Synonyms |
Asparasone A
|
|
CAS | NA | |
PubChem CID | 10808295 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 358.3 | ALogp: | 1.4 |
HBD: | 5 | HBA: | 8 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 152.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 26 | QED Weighted: | 0.475 |
Caco-2 Permeability: | -5.921 | MDCK Permeability: | 0.00000426 |
Pgp-inhibitor: | 0.015 | Pgp-substrate: | 0.129 |
Human Intestinal Absorption (HIA): | 0.457 | 20% Bioavailability (F20%): | 0.805 |
30% Bioavailability (F30%): | 0.997 |
Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 93.95% |
Volume Distribution (VD): | 0.644 | Fu: | 11.50% |
CYP1A2-inhibitor: | 0.88 | CYP1A2-substrate: | 0.15 |
CYP2C19-inhibitor: | 0.029 | CYP2C19-substrate: | 0.047 |
CYP2C9-inhibitor: | 0.6 | CYP2C9-substrate: | 0.554 |
CYP2D6-inhibitor: | 0.072 | CYP2D6-substrate: | 0.178 |
CYP3A4-inhibitor: | 0.105 | CYP3A4-substrate: | 0.05 |
Clearance (CL): | 10.225 | Half-life (T1/2): | 0.904 |
hERG Blockers: | 0.067 | Human Hepatotoxicity (H-HT): | 0.119 |
Drug-inuced Liver Injury (DILI): | 0.973 | AMES Toxicity: | 0.526 |
Rat Oral Acute Toxicity: | 0.018 | Maximum Recommended Daily Dose: | 0.825 |
Skin Sensitization: | 0.946 | Carcinogencity: | 0.047 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.911 |
Respiratory Toxicity: | 0.202 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000935 | ![]() |
0.646 | D0K8KX | ![]() |
0.344 | ||
ENC001929 | ![]() |
0.646 | D04AIT | ![]() |
0.309 | ||
ENC000571 | ![]() |
0.632 | D0N1FS | ![]() |
0.303 | ||
ENC005279 | ![]() |
0.600 | D07MGA | ![]() |
0.300 | ||
ENC000335 | ![]() |
0.582 | D0AZ8C | ![]() |
0.275 | ||
ENC000094 | ![]() |
0.577 | D0C9XJ | ![]() |
0.268 | ||
ENC001058 | ![]() |
0.575 | D07VLY | ![]() |
0.268 | ||
ENC000864 | ![]() |
0.554 | D01XDL | ![]() |
0.265 | ||
ENC002296 | ![]() |
0.538 | D01XWG | ![]() |
0.265 | ||
ENC005489 | ![]() |
0.523 | D0H1AR | ![]() |
0.264 |