|
Name |
Ergosta-4,6,8(14),22-tetraen-3-one
|
Molecular Formula | C28H40O | |
IUPAC Name* |
(9R,10R,13R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one
|
|
SMILES |
C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CCC2=C3C=CC4=CC(=O)CC[C@@]4([C@H]3CC[C@]12C)C
|
|
InChI |
InChI=1S/C28H40O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,17-20,24,26H,11-16H2,1-6H3/b8-7+/t19-,20+,24+,26-,27-,28+/m0/s1
|
|
InChIKey |
OIMXTYUHMBQQJM-HSVWHVBGSA-N
|
|
Synonyms |
Ergosta-4,6,8(14),22-tetraen-3-one; 19254-69-4; Ergone; Ergosta-4,6,8(14),22-tetraen-3-one, (22E)-; RI51Y55U8P; (22E)-Ergosta-4,6,8(14),22-tetraen-3-one; (9R,10R,13R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one; (22e,24r)-ergosta-4,6,8(14),22-tetraen-3-one; UNII-RI51Y55U8P; SCHEMBL6365010; CHEMBL3588948; CHEBI:69431; DTXSID201296846; ZINC5761087; NSC785136; AKOS022184779; NSC-785136; (22E)-Ergosta-4,6,8(14),22-tetren-3-one; 24-methylcholesta-4,6,8(14),22-tetraen-3-one; Q27104972; (22E)-4,6,8(14),22-ERGOSTATETRAEN-3-ONE
|
|
CAS | 19254-69-4 | |
PubChem CID | 6441416 | |
ChEMBL ID | CHEMBL3588948 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 392.6 | ALogp: | 6.8 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 17.1 | Aromatic Rings: | 4 |
Heavy Atoms: | 29 | QED Weighted: | 0.449 |
Caco-2 Permeability: | -5.091 | MDCK Permeability: | 0.00001830 |
Pgp-inhibitor: | 1 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.982 |
30% Bioavailability (F30%): | 0.888 |
Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 91.65% |
Volume Distribution (VD): | 1.864 | Fu: | 1.91% |
CYP1A2-inhibitor: | 0.115 | CYP1A2-substrate: | 0.788 |
CYP2C19-inhibitor: | 0.516 | CYP2C19-substrate: | 0.958 |
CYP2C9-inhibitor: | 0.519 | CYP2C9-substrate: | 0.163 |
CYP2D6-inhibitor: | 0.382 | CYP2D6-substrate: | 0.41 |
CYP3A4-inhibitor: | 0.905 | CYP3A4-substrate: | 0.924 |
Clearance (CL): | 1.039 | Half-life (T1/2): | 0.244 |
hERG Blockers: | 0.431 | Human Hepatotoxicity (H-HT): | 0.249 |
Drug-inuced Liver Injury (DILI): | 0.151 | AMES Toxicity: | 0.021 |
Rat Oral Acute Toxicity: | 0.678 | Maximum Recommended Daily Dose: | 0.969 |
Skin Sensitization: | 0.957 | Carcinogencity: | 0.024 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.035 |
Respiratory Toxicity: | 0.942 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004737 | 1.000 | D06JPB | 0.379 | ||||
ENC004022 | 1.000 | D0G8OC | 0.368 | ||||
ENC003368 | 0.852 | D0G5CF | 0.361 | ||||
ENC003739 | 0.800 | D0G8BV | 0.346 | ||||
ENC003880 | 0.780 | D0F1UL | 0.346 | ||||
ENC003667 | 0.778 | D04GJN | 0.298 | ||||
ENC004736 | 0.758 | D0Z1XD | 0.294 | ||||
ENC004834 | 0.742 | D06XMU | 0.287 | ||||
ENC004998 | 0.737 | D07BSQ | 0.286 | ||||
ENC002984 | 0.688 | D04ATM | 0.284 |