![]() |
Name |
Icosyl oleate
|
Molecular Formula | C38H74O2 | |
IUPAC Name* |
icosyl (Z)-octadec-9-enoate
|
|
SMILES |
CCCCCCCCCCCCCCCCCCCCOC(=O)CCCCCCC/C=C\CCCCCCCC
|
|
InChI |
InChI=1S/C38H74O2/c1-3-5-7-9-11-13-15-17-19-20-21-23-25-27-29-31-33-35-37-40-38(39)36-34-32-30-28-26-24-22-18-16-14-12-10-8-6-4-2/h18,22H,3-17,19-21,23-37H2,1-2H3/b22-18-
|
|
InChIKey |
HKJBUPVMFYBSHI-PYCFMQQDSA-N
|
|
Synonyms |
Icosyl oleate; Arachidyl oleate; 22393-88-0; icosyl (Z)-octadec-9-enoate; eicosanyl 9Z-octadecenoate; Oleic acid, eicosyl ester; eicosyl 9Z-octadecenoate; 88N4Q56WPT; WE(20:0/18:1(9Z)); 9-Octadecenoic acid (Z)-, eicosyl ester; Oleic acid arachidyl ester; UNII-88N4Q56WPT; EINECS 244-951-1; Oleic acid icosyl ester; icosan-1-ol oleate ester; icosanyl (9Z)-octadecenoate; icosyl (9Z)-octadec-9-enoate; CHEBI:75628; Icosyl (9E)-9-octadecenoate #; DTXSID901316562; 1-O-eicosanyl (9Z)-octadecenoate; LMFA07010165; ZINC96095365; FA(38:1); 9-OCTADECENOIC ACID (9Z)-, EICOSYL ESTER; Q27145430
|
|
CAS | 22393-88-0 | |
PubChem CID | 6436542 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 563.0 | ALogp: | 17.5 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 35 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 40 | QED Weighted: | 0.035 |
Caco-2 Permeability: | -5.313 | MDCK Permeability: | 0.00000306 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.015 | 20% Bioavailability (F20%): | 0.537 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 104.39% |
Volume Distribution (VD): | 5.352 | Fu: | 0.38% |
CYP1A2-inhibitor: | 0.02 | CYP1A2-substrate: | 0.11 |
CYP2C19-inhibitor: | 0.084 | CYP2C19-substrate: | 0.041 |
CYP2C9-inhibitor: | 0.013 | CYP2C9-substrate: | 0.979 |
CYP2D6-inhibitor: | 0.036 | CYP2D6-substrate: | 0.022 |
CYP3A4-inhibitor: | 0.153 | CYP3A4-substrate: | 0.012 |
Clearance (CL): | 4.024 | Half-life (T1/2): | 0.051 |
hERG Blockers: | 0.838 | Human Hepatotoxicity (H-HT): | 0.007 |
Drug-inuced Liver Injury (DILI): | 0.17 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.011 | Maximum Recommended Daily Dose: | 0.022 |
Skin Sensitization: | 0.989 | Carcinogencity: | 0.019 |
Eye Corrosion: | 0.807 | Eye Irritation: | 0.923 |
Respiratory Toxicity: | 0.491 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002399 | ![]() |
0.905 | D00AOJ | ![]() |
0.508 | ||
ENC001705 | ![]() |
0.849 | D0O1PH | ![]() |
0.419 | ||
ENC000437 | ![]() |
0.719 | D0Z1QC | ![]() |
0.393 | ||
ENC000381 | ![]() |
0.715 | D00STJ | ![]() |
0.392 | ||
ENC000576 | ![]() |
0.709 | D01NTX | ![]() |
0.386 | ||
ENC000443 | ![]() |
0.708 | D07ILQ | ![]() |
0.372 | ||
ENC000438 | ![]() |
0.705 | D00FGR | ![]() |
0.362 | ||
ENC000436 | ![]() |
0.697 | D0Z5SM | ![]() |
0.326 | ||
ENC000435 | ![]() |
0.686 | D00MLW | ![]() |
0.322 | ||
ENC000401 | ![]() |
0.675 | D06KDP | ![]() |
0.314 |