![]() |
Name |
Geranyllinalool
|
Molecular Formula | C20H34O | |
IUPAC Name* |
(6E,10E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol
|
|
SMILES |
CC(=CCC/C(=C/CC/C(=C/CCC(C)(C=C)O)/C)/C)C
|
|
InChI |
InChI=1S/C20H34O/c1-7-20(6,21)16-10-15-19(5)14-9-13-18(4)12-8-11-17(2)3/h7,11,13,15,21H,1,8-10,12,14,16H2,2-6H3/b18-13+,19-15+
|
|
InChIKey |
IQDXAJNQKSIPGB-HQSZAHFGSA-N
|
|
Synonyms |
Geranyllinalool; Geranyl linalool; 1113-21-9; 3,7,11,15-Tetramethyl-1,6,10,14-hexadecatetraen-3-ol; 3,7,11,15-Tetramethylhexadeca-1,6,10,14-tetraen-3-ol; (E,E)-geranyllinalool; (6E,10E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol; 1,6,10,14-Hexadecatetraen-3-ol, 3,7,11,15-tetramethyl-, (6E,10E)-; (6E,10E)-geranyllinalool; (E,E)-3,7,11,15-Tetramethylhexadeca-1,6,10,14-tetraen-3-ol; VV41XXJ67L; 1,6,10,14-Hexadecatetraen-3-ol, 3,7,11,15-tetramethyl-, (E,E)-; EINECS 214-201-8; UNII-VV41XXJ67L; vanillinazine; Geranyl linallol; Geranyl-linalool; Linalool, geranyl-; E,E-3,7,11,15-Tetramethyl-1,6,10,14-hexadecatetraen-3-ol; SCHEMBL249658; (+/-)-GERANYLLINALOOL; (E,E)-GERANYL LINALOOL; CHEBI:74299; DTXSID70883645; BCP05146; (6E,10E)-3,7,11,15-Tetramethyl-1,6,10,14-hexadecatetraen-3-ol; GERANYL LINALOOL, (+/-)-; MFCD00059363; AKOS015901111; BCP9000724; CS-W012189; DS-14927; Geranyllinalool, technical, >=95% (GC); G0221; C20681; D78106; A802342; SR-01000944850; J-002558; SR-01000944850-1; Q27144589; (6e,6e)-3,7,11,15-tetramethyl-1,6,10,14-hexadecatetraen-3-ol; (6E,10E)-3,7,11,15-Tetramethyl-1,6,10,14-hexadecatetraen-3-ol #
|
|
CAS | 1113-21-9 | |
PubChem CID | 5365872 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 290.5 | ALogp: | 6.4 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 20.2 | Aromatic Rings: | 0 |
Heavy Atoms: | 21 | QED Weighted: | 0.478 |
Caco-2 Permeability: | -4.624 | MDCK Permeability: | 0.00001840 |
Pgp-inhibitor: | 0.408 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.016 | 20% Bioavailability (F20%): | 0.081 |
30% Bioavailability (F30%): | 0.029 |
Blood-Brain-Barrier Penetration (BBB): | 0.14 | Plasma Protein Binding (PPB): | 97.57% |
Volume Distribution (VD): | 1.699 | Fu: | 2.56% |
CYP1A2-inhibitor: | 0.352 | CYP1A2-substrate: | 0.176 |
CYP2C19-inhibitor: | 0.515 | CYP2C19-substrate: | 0.845 |
CYP2C9-inhibitor: | 0.509 | CYP2C9-substrate: | 0.945 |
CYP2D6-inhibitor: | 0.739 | CYP2D6-substrate: | 0.086 |
CYP3A4-inhibitor: | 0.896 | CYP3A4-substrate: | 0.196 |
Clearance (CL): | 5.726 | Half-life (T1/2): | 0.188 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.216 |
Drug-inuced Liver Injury (DILI): | 0.007 | AMES Toxicity: | 0.001 |
Rat Oral Acute Toxicity: | 0.001 | Maximum Recommended Daily Dose: | 0.147 |
Skin Sensitization: | 0.959 | Carcinogencity: | 0.022 |
Eye Corrosion: | 0.251 | Eye Irritation: | 0.935 |
Respiratory Toxicity: | 0.007 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001606 | ![]() |
0.750 | D05XQE | ![]() |
0.568 | ||
ENC000314 | ![]() |
0.750 | D09XWD | ![]() |
0.551 | ||
ENC001096 | ![]() |
0.650 | D03VFL | ![]() |
0.473 | ||
ENC001462 | ![]() |
0.650 | D01ZUA | ![]() |
0.231 | ||
ENC001466 | ![]() |
0.646 | D0M1PQ | ![]() |
0.224 | ||
ENC001465 | ![]() |
0.646 | D06BLQ | ![]() |
0.184 | ||
ENC001464 | ![]() |
0.574 | D07PCI | ![]() |
0.167 | ||
ENC002413 | ![]() |
0.571 | D0X7XG | ![]() |
0.165 | ||
ENC001717 | ![]() |
0.571 | D0S7WX | ![]() |
0.165 | ||
ENC001467 | ![]() |
0.525 | D0UE9X | ![]() |
0.165 |