![]() |
Name |
9,12,15-Octadecatrienoic acid, 2-[(trimethylsilyl)oxy]-1-[[(trimethylsilyl)oxy]methyl]ethyl ester, (Z,Z,Z)-
|
Molecular Formula | C27H52O4Si2 | |
IUPAC Name* |
1,3-bis(trimethylsilyloxy)propan-2-yl (9E,12E,15E)-octadeca-9,12,15-trienoate
|
|
SMILES |
CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C
|
|
InChI |
InChI=1S/C27H52O4Si2/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(28)31-26(24-29-32(2,3)4)25-30-33(5,6)7/h9-10,12-13,15-16,26H,8,11,14,17-25H2,1-7H3/b10-9+,13-12+,16-15+
|
|
InChIKey |
JCKCKIGYQKMCHR-WYTUUNCASA-N
|
|
Synonyms |
2-Monolinolenin, 2TMS derivative; 9,12,15-Octadecatrienoic acid, 2-[(trimethylsilyl)oxy]-1-[[(trimethylsilyl)oxy]methyl]ethyl ester, (Z,Z,Z)-; (9Z,12Z,15Z)-9,12,15-Octadecatrienoic acid 2-trimethylsilyloxy-1-[(trimethylsilyloxy)methyl]ethyl ester; 2-[(Trimethylsilyl)oxy]-1-([(trimethylsilyl)oxy]methyl)ethyl (9E,12E,15E)-9,12,15-octadecatrienoate #; 55521-23-8
|
|
CAS | NA | |
PubChem CID | 5362857 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 496.9 | ALogp: | 8.2 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 21 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 44.8 | Aromatic Rings: | 0 |
Heavy Atoms: | 33 | QED Weighted: | 0.069 |
Caco-2 Permeability: | -5.221 | MDCK Permeability: | 0.00012300 |
Pgp-inhibitor: | 0.863 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.022 | 20% Bioavailability (F20%): | 0.806 |
30% Bioavailability (F30%): | 0.967 |
Blood-Brain-Barrier Penetration (BBB): | 0 | Plasma Protein Binding (PPB): | 101.30% |
Volume Distribution (VD): | 2.886 | Fu: | 1.29% |
CYP1A2-inhibitor: | 0.229 | CYP1A2-substrate: | 0.891 |
CYP2C19-inhibitor: | 0.185 | CYP2C19-substrate: | 0.192 |
CYP2C9-inhibitor: | 0.816 | CYP2C9-substrate: | 0.953 |
CYP2D6-inhibitor: | 0.089 | CYP2D6-substrate: | 0.726 |
CYP3A4-inhibitor: | 0.73 | CYP3A4-substrate: | 0.126 |
Clearance (CL): | 2.293 | Half-life (T1/2): | 0.765 |
hERG Blockers: | 0.295 | Human Hepatotoxicity (H-HT): | 0.136 |
Drug-inuced Liver Injury (DILI): | 0.006 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0 | Maximum Recommended Daily Dose: | 0.922 |
Skin Sensitization: | 0.98 | Carcinogencity: | 0.069 |
Eye Corrosion: | 0.997 | Eye Irritation: | 0.936 |
Respiratory Toxicity: | 0.876 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001549 | ![]() |
0.542 | D0O1TC | ![]() |
0.481 | ||
ENC001661 | ![]() |
0.480 | D0UE9X | ![]() |
0.437 | ||
ENC001715 | ![]() |
0.459 | D0G2MW | ![]() |
0.404 | ||
ENC001605 | ![]() |
0.452 | D0OR6A | ![]() |
0.354 | ||
ENC001660 | ![]() |
0.452 | D0Q5XX | ![]() |
0.322 | ||
ENC001583 | ![]() |
0.439 | D00MLW | ![]() |
0.316 | ||
ENC002254 | ![]() |
0.438 | D0H2YX | ![]() |
0.308 | ||
ENC001711 | ![]() |
0.427 | D0O1PH | ![]() |
0.287 | ||
ENC001714 | ![]() |
0.427 | D0PS6X | ![]() |
0.284 | ||
ENC001845 | ![]() |
0.416 | D0G7WY | ![]() |
0.250 |