|
Name |
(-)-Terpinen-4-ol
|
Molecular Formula | C10H18O | |
IUPAC Name* |
(1R)-4-methyl-1-propan-2-ylcyclohex-3-en-1-ol
|
|
SMILES |
CC1=CC[C@](CC1)(C(C)C)O
|
|
InChI |
InChI=1S/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3/t10-/m0/s1
|
|
InChIKey |
WRYLYDPHFGVWKC-JTQLQIEISA-N
|
|
Synonyms |
(-)-Terpinen-4-ol; 20126-76-5; (-)-4-Terpineol; 3-Cyclohexen-1-ol, 4-methyl-1-(1-methylethyl)-, (1R)-; 4-Terpinenol, L-; (R)-Terpinen-4-ol; (R)-4-Carvomenthenol; p-Menth-1-en-4-ol, (R)-(-)-; 4-Terpineol, (-)-; 4-Carvomenthenol, (-)-; 3-Cyclohexen-1-ol, 4-methyl-1-(1-methylethyl)-, (R)-; (R)-(-)-p-Menth-1-en-4-ol; (1R)-4-methyl-1-propan-2-ylcyclohex-3-en-1-ol; 8VI196VS5T; (R)-4-Methyl-1-(1-methylethyl)-3-cyclohexen-1-ol; (1R)-4-Methyl-1-(1-methylethyl)-3-cyclohexen-1-ol; L-4-terpineneol; L-4-terpineol; L-terpinen-4-ol; (R)-p-Menth-1-en-4-ol; UNII-8VI196VS5T; (R)-1-Isopropyl-4-methyl-3-cyclohexen-1-ol; MFCD00167108; 1-Isopropyl-4-methyl-3-cyclohexen-1-ol, (R)-; P-Meth-1-en-4-OL; CHEMBL2287509; SCHEMBL13180470; DTXSID101033857; ZINC4262096; AKOS028109360; (-)-Terpinen-4-ol, analytical standard; AS-10641; (R)-1-isopropyl-4-methylcyclohex-3-en-1-ol; D91315; EN300-7413298; J-013035; (1R)-4-methyl-1-(propan-2-yl)cyclohex-3-en-1-ol; Q27271081; 3-Cyclohexen-1-ol,4-methyl-1-(1-methylethyl)-,(1R)-; (-)-Terpinen-4-ol, >=95.0% (sum of enantiomers, GC); 3-Cyclohexen-1-ol,4-methyl-1-(1-methylethyl)-, (1R)-
|
|
CAS | 20126-76-5 | |
PubChem CID | 5325830 | |
ChEMBL ID | CHEMBL2287509 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 154.25 | ALogp: | 2.2 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 11 | QED Weighted: | 0.575 |
Caco-2 Permeability: | -4.191 | MDCK Permeability: | 0.00002050 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.681 |
30% Bioavailability (F30%): | 0.035 |
Blood-Brain-Barrier Penetration (BBB): | 0.576 | Plasma Protein Binding (PPB): | 90.27% |
Volume Distribution (VD): | 2.457 | Fu: | 9.94% |
CYP1A2-inhibitor: | 0.558 | CYP1A2-substrate: | 0.346 |
CYP2C19-inhibitor: | 0.179 | CYP2C19-substrate: | 0.816 |
CYP2C9-inhibitor: | 0.089 | CYP2C9-substrate: | 0.843 |
CYP2D6-inhibitor: | 0.037 | CYP2D6-substrate: | 0.252 |
CYP3A4-inhibitor: | 0.059 | CYP3A4-substrate: | 0.252 |
Clearance (CL): | 9.363 | Half-life (T1/2): | 0.528 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.075 |
Drug-inuced Liver Injury (DILI): | 0.054 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.017 | Maximum Recommended Daily Dose: | 0.02 |
Skin Sensitization: | 0.698 | Carcinogencity: | 0.543 |
Eye Corrosion: | 0.664 | Eye Irritation: | 0.985 |
Respiratory Toxicity: | 0.026 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000388 | 1.000 | D06GIP | 0.208 | ||||
ENC001077 | 0.469 | D04CSZ | 0.208 | ||||
ENC003268 | 0.423 | D0P1UX | 0.197 | ||||
ENC005115 | 0.407 | D07QKN | 0.196 | ||||
ENC000520 | 0.366 | D08KVZ | 0.194 | ||||
ENC004025 | 0.358 | D0O3FG | 0.188 | ||||
ENC005252 | 0.348 | D0H1QY | 0.184 | ||||
ENC000588 | 0.346 | D01CKY | 0.181 | ||||
ENC001824 | 0.346 | D0A2AJ | 0.179 | ||||
ENC002392 | 0.346 | D03KEK | 0.174 |